0
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
Still curious? Ask our experts.
Chat with our AI personalities
JudySimplicity is my specialty.
Chat with Judy
ViviYour ride-or-die bestie who's seen you through every high and low.
Chat with Vivi
CoachSuccess isn't just about winning—it's about vision, patience, and playing the long game.
Chat with CoachAdd your answer:
Earn +20 ptsQ: What’s 2×4
Write your answer...
Submit
Still have questions?
Trending Questions
How do you get a borg cube in Flash Trek Broken Mirror?
A sentence for omit?
How do you replace the headlight in a 1969 Beetle?
What is the HCF of 2 and 0?
If two transverse waves have the same wavelength the wave with the what has the greatest wave speed.?
How many sisters does kat deluna has?
What services does the Rightmoves website offer?
What correctly renames 78 and 56 using a common denominator?
What is Lysozyme and penicillin?
Where do rastafarians pilgrimage?
Who is Henry John Deutschendorf Jr?
What size engine does the 2008 Mitsubishi Lancer have?
What hemisphere is Yangtze River located?
What fraction of the flag is green?
What is the chemical formula for bromine gas?
What temperature is regular ice water at?
What is the most common bone to brake while skateboarding?
Is their such thing as a black and white mouse?
How does one go about becoming an Arbonne International consultant?
What rhymes with rontu?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.