0
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What else can I help you with?
Related Questions
Whats 3 times 8?
24
6 12 18 whats next?
24
Whats 24 off of 300?
24 of 300 can be expressed as 0.08. It is the same as saying 0.08.
Whats -1 3 plus -3 8?
-1/3 + (-3/8) = -8/24 - 9/24 = -17/24.
Do you need to change brakes and rotors if you put 24 inch rims on your truck?
Whats to best rotors for 24 in rims
Whats Ashley Tisdales favourite TV show?
24 (twenty four)
Whats the ratio of 24 cm. long and 16 cm. wide?
The ratio is 3:2
Whats minimum GPA needed to get into University of Louisville?
what is the minimum GPA requirements to get into the university of Louisville
How much is 24 kt ep necklace that weighs 68 grams whats it worth?
700 euro
Whats the next number in the series 16 24 36 52 68?
84 16+8=24 24+12=36 36+16=52 52+16=68 68+16=84
Whats an episode?
An episode is a part or portion of something like a television program. A season usually has 12 to 24 episodes.
whats negative one and one sixth times one fourth?
-7/6 * 1/4 = -7/24
Trending Questions
What is the gross vehicle weight of the 2004 Ford Expedition?
Why is there a bad smell in your bathroom?
Why are hobos so mean?
What are the 2006 Kia Sodona engine codes P2106 P1295 P161B?
Where did the confederation surrender at end of the American Civil War?
How do you say James in hawaiian?
Why is there smoke coming from air conditioner vent while air is off?
How many times does 25 go into 197?
Will fluorine and sulfur form and ionic compound?
Why would you expect extrusive rocks produced by an explosive volcano to be light or dark in color?
How does slavery victimize both the slave and the slaver?
What is 363 divided by 1.1?
How many 2008 dodge charger daytona were built?
What were Ferdinand Magellans hobbies interests?
When a number is added to its additive inverse what is the sum equals to?
What is beyonces job?
What kind of services does Olin Credit Union offer?
How do you tell someone to smile in Spanish?
Carbs per day to lose weight fast?
What is matting in adobe photoshop?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.