0
-1
Chad Rath
Add your answer:
Earn +20 pts
How do you type a cubed number on a keyboard?
If you aren't able to type 33, use 3^3
What type of shape has exaclty 3 sides?
A triangle has 3 sides
How to type square root 3?
axa=answer
What is a Type of triangle with 3 congruent sides?
It is an equilateral triangle that has 3 congruent sides
What type or triangle has 3 equal sides and 3 equal angles?
an equilateral triangle
What are compounds with the same simple formula but different 3-dimensional structures called?
Isomer's
How many isomers in menthol?
Since each menthol isomer has 3 stereocenters, menthol has a total of 8 stereoisomers.
How many isomer does pentane have?
Three: pentane, 2-methylbutane (isopentane), and 2,2-dimethylpropane (neopentane).
What is the nomenclature for ch3-ch2-chch-ch2-ch2-ch3?
This could be termed as "3-heptene" or "hept-3-ene". Depending on the geometric isomers you could add the prefix cis or trans. If the 2 H atoms are on one side and the hydrocarbon chain on the other side, then it is the cis isomer. If the groups are on either sides , then it is the trans isomer.
What is a benzvalene?
A benzvalene is a highly reactive tricyclic unsaturated hydrocarbon, tricyclo[3.1-0.02,6]hex-3-ene, which is a valence isomer of benzene.
What are the chirality centers for the alkene C6H12?
It depends upon structure and position of double bond 1-hexene, 2-hexene and 3-hexene do not have the chiral center their isomer 3-methyl-1-pentene has a chiral center which is carbon no 3.
What are examples of 3 syllable words beginning with I?
isomer, insolent, Italian, insolvent, indigent, impala, isolate, isobar, intention, ibises, inculcate, Iowa, incubus, iodine, irises, icicle, iconic...
How can you type hearts?
type a < and then type a 3 <3
Write condensed structures for 3-ethylhexane?
C8H18 this is condensed formula for 3-ethyl hexane but this formula has some other isomers. This particular isomer 3-ethyl hexane is CH3-CH2-CH(C2H5)-CH2-CH2-CH3.
Which type of incident require resources that exceed the intitial response and include aircraft crashes and hostage situations?
Type 3
How do i type 250 to the power of 3?
You type it like this: 250^3
Isomer of ketone with formula C5H10O?
2-hexanone3-hexanone2-methyl-3-pentanone3-methyl-2-pentanone4-methyl-2-pentanone3,3-dimethyl-2-butanone
