0
What else can I help you with?
Related Questions
Do the prime factorizations of 60 50 and 35 have equal factors?
No.
What is the prime factorizations of the number 60?
2 x 2 x 3 x 5 = 60
What prime factorizations go into 60?
2, 3, and 5 are prime factors of 60 2 times 2 times 3 times 5 = 60
What are the prime factorizations for 60 120 160 and 300?
For 60, it is 23x3x5. For 120, it is 24x3x5. For 160, it is 26x5. For 300, it is 22x3x52.
What are all the prime factorizations of 10?
10 = 2 × 5
What is the LCM of a pair of numbers whose prime factorizations are 2x2x3x5 and 2x3x3?
The LCM of 60 and 18 is 180
Are there any prime factorizations for 52?
2x2x13 these are all of the prime factors that multiply to equal 52
What are all the prime factorizations of 58?
2 x 29 = 58
What are all the prime factorizations of 432?
24 x 33 = 432
What are all of the prime factorizations of 32?
Prime factorization of 32 = 2 * 2 * 2 * 2 * 2
What is all the prime factorizations of 49?
49 = 7 x 7 or 72
What r prime factorizations?
Prime factorizations are expressions of numbers as products of prime factors. The prime factorization of 30 is 2 x 3 x 5.
Trending Questions
Why was there a gun powder plot?
After world war 1 the general feeling of the most Americans was?
DUI and your credit?
California high beams headlights are required to illuminate objects to a distance of how many feet?
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
What makes plastic melt?
Interior light goes off and then comes back on?
What is pictogragh?
Do magnets have a chemical bond?
What is regulation time in soccer?
What is the Distance from home to pitchers mound in fast pitch softball?
Your flipnote studio on your dsi doesnt work?
Why is Huck glad that tom will not go to heaven?
What is lowes overnight mailing address?
Is Rachel McAdams nice?
Can you use bb's in a spring boy xm8 airsoft gun?
What are porposise?
What word has the same vowel sound as soap mop train coat time dog?
What is the statute of limitations of a non moving violation tickets in Missouri?
How do paramecium excrete?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.