0
What are the spectator ions in Na plus plus OH- plus CI- H2O plus Na plus plus CI?
Wiki User
∙ 6y agoWant this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
How many syllables are in the word principal?
Three: prin-ci-palPrin-ci-pal. Three.It has 3 syllables. Prin-ci-pal.
What is CI - XL VIII?
If you mean as in Roman numerals CI - XLVIII then it is LIII
What is ci in roman numerals?
The Roman numeral "CI" represents the number 101.
What is the Roman numeral for 101?
the answer to what is the roman numeral for 101 is CI
What is CI minus XL VIII?
If you mean CI minus XLVIII then it is LIII because 101 minus 48 = 53
What is the correct name for an ionic compound made up of calcium ions Ca2 plus and chloride ions CI?
Calcium Chloride
which equation is balance in a basic solution?
CIO H2O 2e- CI- 2OH
What is the complete ionic equation for NaOH plus HC equals H2O plus NaCl?
C6H8O6+NaHCO3<->CO2(g)+H2O(liq)+C6H7O6-+Na+
What is a Welsh canine?
As in what is dog in Welsh?, chi or ci (plus other mutations).
Which ions has the same electron configuration of a noble gas ca or ci?
Cl- and Ca2+ has the electronic configuration of the noble gas, Ar, with 18 electrons.
What is the protons in one neutral atom of CI?
Carbon has 6 protons and Iodine has 53, though to my knowledge, they usually combine to form Carbon Tetraiodide (with four Iodide ions) and not CI. But I'm no chemist. CI is also a common misspelling of Cl (with a lowercase L) Cl is the elements chlorine with 17 protons.
What is the oxidation state of CI in HCI04?
It has plus 7 oxidation state.It is in highest oxidation state.
Where can you get a job application for Ci Ci's Pizza?
At Ci Ci's Pizza.
How many atoms of oxygen are in 6CO2 H2O C6H12 6O2?
There are 6 atoms of H20 in CoCI2 x 6H20. I'm not sure, but there are also 1 Co atom and 2 CI atoms since it's Co and CI 2 <----- Subtext represents how many of the atoms there are for that element, in this case, CI. Hope my answer's right >_-
The main ions in sea water are?
The four MAIN IONS in seawater in descending order of abundance are: CI: Chloride Na: Sodium SO4: Sulfate Mg: magnesium Found in Leckie-Yuretich: Investigating the Ocean, Page 114, Seawater Salinity: The salt of the Ocean
What does ci mean in Roman Numerals?
It is: CI = 101
What is the balance of the equation caco3 2hcico2 H2O caci2?
you would need to know which of those are reactants and which were products, and there is no Ci element, and i am nowhere good enough to take those (if they are reactants) and come up with a product.
