0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
How do you conquer a npc on evony?
What information is needed for a car loan application?
Does changing the distance of a ramp affect the distance the car travel?
Where did mom-mom originate?
Can goats safely consume fresh cut grass?
How much does a coconut crab weigh?
What ended in 1865?
How does stepping on weeds affect them?
What is the capacity of a class 460?
How long after adding chlorine powder to your pool is it safe to swim?
What is Kevin Kreider's occupation from 'Jon and Kate Plus 8'?
Why do dare devils like to take risk?
How does temperature affect the taste of food?
Who was the political advisor to victor emanuel II?
How can I keep my yard odor away?
When a rocket is launched is it physical chemical or nuclear change?
Why was the unit for gravitational differences named after galelio?
How many vaccinations do dwarf rabbits need?
How old was Walther Bothe at death?
What British law taxed all legal and commercial documents?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.