0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
Is an eyewitness report in the first person?
Are any of the old actors still on Law and Order what about the lady?
When did Adele Lamont die?
Does numb and sensitive mean the same thing?
What is the number of electron whose mass number is 75 and whose number of neutrons is 42?
What is a cria?
How many subway are in each of these countries?
Create a simple sum that adds up to 12 If you have to use the same number three times and you cannot use the number 4?
Does tooth enamel repair itself?
When did Kimberly Guilfoyle get married?
How tall is Natalie Appleton?
How can I conduct research on mutual funds for free?
How many edges does a hextagon prism have?
What are the characteristics of vampires?
How many steps are there between a flat and a sharp?
What direction would you go if you traveled from Virginia to Mississippi?
Can you grow apples in Ireland?
What are some five letter words with 3rd letter R and 4th letter G and 5th letter Y?
What are the resonance structures of ClO2 and how do they contribute to the overall stability of the molecule?
What was the design on Scorpio from the rough ryders first stunt bike?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.