0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
How many millionaires are in Mexico?
What is the percentage of 33 out of 86?
What fraction is equivilant to 0.3?
Can you block egr valve off on a terrano?
When was the second i Phone invented?
What Chrysler cars has the 4.7 engine?
Did the WW2 bring more good impacts than bad impacts to the world?
Who was Abraham Lincoln's vice president in 1865?
What actors and actresses appeared in El estudio de Pedro Vargas - 1959?
Who or what will cause the apocalypse?
Did women play league baseball in skirts?
What are some good options in order to find sweet Cocker Spaniel puppies for sale in Florida?
How much do mg cars cost?
Can plants survive without sunlight?
Does UV radiation kill fish?
Historically which empire was most associated with having control of the Baltic states?
What will happen if calcium channels are blocked?
How does inequality among men and women affects a community?
Is copper II hydroxide a compound or an element?
Why is Minecraft called Minecraft?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.