0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
How can I effectively tie two ropes together?
The Scarlet Ibis indirect and direct characterization?
Is Peru in eastern or western hemisphere?
When will agomelatine be released?
What can you do after you get married in sims castaway 2?
Why is it cooler in the mountains compared to lower elevations?
How many times does two go into forty two?
What events in the order in which they happened to call?
What is the objective of solving linear project?
What is Marks and Spencers phone number in Cheshunt?
What is 80005-30480?
What is call and put in stock market?
What is the theory that helps explain the causes of both earthquakes and volcanoes is the theory of?
What is a closed packed plane?
Are insects needed to pollinate flowers?
If you get shot with a bb gun and it looks blue is it infected?
What was a reaction to the increased urbanization and secularization and new science of the twenties?
What is the process by which sediments are pushed together in layers to form sedimentary rock?
Would you find more species in a forest or open field?
Who makes up the higher percentage of college students men or women?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.