0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
Are electrons shared equally in NH3?
Does joint tenancy supercede a will?
What is the difference between a gorilla and an Australopithecus?
How do you clear FaceTime count on icon?
How can I effectively repair a leather hole?
What is pipeline free span?
Why has your speedo n rev counter stop workin astra coupe?
How can I fix cabinet doors that are not closing properly?
Which unit is more precise gallons quarts pints cups?
How does a structure break when tension is too great?
Where is the main setting in the book On the wings of heroes?
What are the names of Zeus parents names?
In the parable of the lost son why was the fattened calf the sign of a special occasion?
What is good luck charlies address?
What are the similarities and differences between numbers and words?
Ethnicity last name Au?
What does Every friend whom not thy fantastic will but the great and the tender soul in thee craveth shall lock thee in embrace mean?
Where is Kennedy van saun corporation?
What is least to greatest?
Where does the first sun rays on earth falls?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.