0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
How do you say opera in French?
Did the 1966 dodge coronet 500 have rear seat belt as a factory option?
What is the new darts walk on girls name?
What is the prime factors of 700 a 2x2x2x5x5x7 b 350x2 c 2x2x25x7 d 2x2x5x5x7?
Why alkenes undergo addition reaction?
What is 6 times 4 and 5 fifths plus 8 times 3 and 5 fifths?
What group of mamals does a horse belong to?
How many times does 3 go into 129?
What prime number between 3 and 50 can be divided by 4 with a remainder of 3 and is a factor of 76?
A bolt that is threaded into a casting is called?
Who did he fight for?
Is there a law on hacked games?
How much does a visa to Canada cost in Jamaica?
Find outquadrilateral whose diagonals or perpendicular to each other but unequal?
How big was Noah's ark?
How many bags of cement for concrete topping of 2 inches thick?
What is a 797b dump truck?
Who was elected to be the first Governor over new Plymouth?
How do you spell Christine in French?
What was the Average house price 1980?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.