0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
Who is ripp donn?
How much does a emirates air hostess earn yearly?
Where can I Legally watch family guy free?
I feel like your head is stuffy and your top of your head have a burning problem and both feet tingel?
What is the formula for calculating heat capacity and how is it used in determining the amount of heat absorbed or released by a substance?
What is uncertainity Principle?
What is a fertilized oocyte called?
How do you say whatever in Korean?
How do you get more ammo in carnivores dinosaur hunter iPhone?
How do you separate small stones from dirt?
What level does manky learn his moves at in Pokemon yellow?
How can one enhance a melody by incorporating harmony?
What is the type of movie is black swan?
Is 2.9 a rational number?
How do you unscramble roddne?
Does eggnog ever have cloves in it?
What two numbers add together to make -4 but times to make -45?
What does the law of conservation of mass state that cannot be created or destroyed during a chemical reaction?
In the 1700 what was the climate in Massachusetts?
What are some statements that can describe global information systems?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.