0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
How can I make delicious ice cream using sweetened condensed milk?
If Diana Ross only sold 75 million records how is she the most successful female artist of all times?
How do you connect one speaker to play both Right and Left output channels of a stereo amplifier and is there a bridging gadget I can purchase from Radio Shack or similar so that it sounds OK?
How many consonants are in the word Adventure?
What is 2 over 10 as a decimal?
How dangerous is it to get flu when already infected with HIV?
Which edition of the UEFA Champions League is on going right now?
What are the three isotopes of the element carbon?
What structure served as the center of the church's activities in Latin America?
What is the Malayalam meaning of decisive?
What is 876 plus 765?
What are the advantage of the separating funnel?
What has being done to save koala bears already?
The process of atoms gaining or losing electrons to become anions or cations?
What is the most common method of programming plc?
How much does a gallon of gasoline cost in usa?
Is Ink is conductor of heat?
How many kids does Robert horry have?
How much does ford transit van do mpg?
What is neymar sponsor?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.