0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
What is the most proximal part of the air distribution system that no longer contains cartilage?
How you would promote a partnership?
What is a FOUR letter word meaning a group of people who share the same interest?
Who founded ruins of troy?
What pingo means in Latin?
What does medium of exchange unit of account store value?
FDI regulations in Japan?
Can you be pregnant and take a pregnancy test and it say no?
What is the history of the Tenderloin San Francisco California?
Energy is released during chemical reactions that occur in?
How do you get lifetime points on sims 3?
Do girls find guys attractive that have shape ups?
Is a flashlight an example of a parallel or series curcuit type?
What planet contains oceans and frozen ice caps?
How many stamps do you need to mail a letter from Florida to Mississippi?
How many people like gain detergent?
Does the price go on top of the fraction?
Where can you refer me to put panoramic sunroof?
How much torque does the engine in the 2007 Ford F-150 have?
Is the banking system in India whether mixed or branch banking?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.