0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is 30 plus 55?
85
What is an equlivent fraction for 25-30?
55
Which is less -30 or - 25?
-55
Trending Questions
Is palmolive soap nonionic sulfactant?
How does precession effect the minimum and maximum value of earths cycle?
Which state has the gray owl state bird?
How did molecule get its name?
What are some types of house fires?
How guns changed the Civil War?
I am sorry for bothering you in french?
If a explorer went into a cave what landscape will he see?
What were the term of the peace of treaty?
Who does voice over for planet fitness commercial?
Who whuold win black widow or king cobra?
What is a colipsion kite?
What is the closest airport to Cabo San Lucas?
How much does asbestos super six cladding weigh?
If you take off lots of layers of skin can you remove a stretch mark?
Can Jasper's be used galaxy 3 tablet?
How do you add transmission fluid Suzuki Verona?
Boyfriend broke up with you and now he wants you back what do you do?
What the use of vasteral?
Does Citibank offer free checking in Maine?
Copyright ©2025 Answers.com. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.