0
What else can I help you with?
Related Questions
What is the answer to 2d plus 25 equals 55?
2d + 25 = 55Therefore 55 - 25 = 2dTherefore, 2d = 30d = 30/2Therefore, d = 15
What is 6hours and 30 minutes plus 55 minutes?
(6 hours 30 minutes) + (55 minutes) = 7 hours 25 minutes
What is 55 over 30 as a mixed number?
55/30 =125/3055/30:= 55÷30= 1 remainder 25= 1 25/30
What is 55 take away 30?
25. 55 minus/subtract/take away 30 = 25.
What is the answer to 5 14 plus 6 12?
Assuming you mean 5/14 + 6/12.... 5/14 = 25/70 and 6/12 = 30/70... 25+30=55... 55/70 simplifies to 11/14
What is 30 plus 25 plus 15 plus 25?
30 + 25 + 15 + 25 = 95
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is 30 plus 25?
The answer is 55. Simply add the numbers together arithmetically as you would for the problem two plus two. To check your work, a calculator is the best option.
What is 25 - 55?
-30
What is an equlivent fraction for 25-30?
55
What is 30 plus 55?
85
Which is less -30 or - 25?
-55
Trending Questions
Was the knife invented in the Stone Age?
Is John Cena an anti christ?
What is the usual length of the menstrual cycle?
Which printer cannot print more than one character at a time?
What kind of noun is fame?
How many phonemes are in the word glue?
Who is the developer of the web?
How many corpsmen in the navy?
What is one advantage of using the dissecting microscope instead of a compound light microscope?
How do you replace Acura mdx Door Lock Actuator?
Why was Eclipse named Eclipse?
What has the author Sonda Riedesel Oppewal written?
How old is craftsman 106.154080 air compressor?
What is English of sandok?
What happens when an earthquake starts?
What kind of martial arts does the CIA use?
How did feudalism the manor economy and the church shape life in western Europe as the region slowly developed a new medieval culture?
What kind of car did Jill have on Tool Time TV Show?
How long does it take to drive 26 miles?
Where is the ecm fuse for 2003 Cadillac Escalade?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.