0
What else can I help you with?
Related Questions
What is the expanded form of 312393205?
300,000,000+10,000,000+2,000,000+300,000+90,000+3,000+200+5.
what is 312393205 in expanded form?
300000000+10000000+2000000+300000+90000+3000+200+5
How do write 312393205 in expanded form?
300,000,000+ 10,000,000+ 2,000,000+ 300,000+ 90,000+ 3,000+ 200+ 5
What is a number written as the sum of the values of its digits called?
The correct answer is "expanded form".
How is the decimal 2.16 written in expanded form?
2.16 written in expanded form = 2 + 0.1 + 0.06
How do you write 300 in expanded form?
300 is already written in expanded form.
What is 3.043 written in expanded form?
3.043 in expanded form is three and forty-three thousandths.
What is 124850 in expanded form?
100,000+20,000+4,000+800+50
What is 1.014 written in expanded form?
1.014
What is 9,167.364 written in expanded form?
95.65
what is 4.902 written in expanded form?
mm
How do you write 409 thousand 720 in expanded form?
Expanded form shows the number expanded into an addition statement. Therefore, 409,720 is written in expanded form as follows: 400,000 + 9,000 + 700 + 20
Trending Questions
Can linked genes ever be separated?
What is 778 to the nearest 10?
What did Andrew Jackson do to influence the government of the U.S. was he awesome?
Is alcohol renewable?
How long do you get discharge from ear after mastoidectomy?
Jessica will visit her grandparents which one is the direct object?
What is the value of a 357 smith and WESSON WITH 4inch barrel?
Does any one know why Yolanda killed Selena Quyitanilla Perez you do not recall it ever being mentioned her reason for killing her?
Did Robert Pattinson ever marry Reese Witherspoon?
Why did some historians think the plague started in central Asia?
Why would the headlights dash lights and the security light come on in a Saturn L200 when the car has been on for an hour or more?
What is a Le burro in volleyball?
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
If a car travels one mile in 45 seconds how fast is it going?
Is coal still used today?
What continent is suisse in?
How many points is a rook worth in chess?
What do polynesian people wear?
What is abstract noun for imagine?
What has the author Ana M Luszczynska written?
Copyright ©2025 Answers.com | Lunias Media Inc. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.