0
What else can I help you with?
Related Questions
What is 20 plus 35 plus 40 plus 55 plus 60 plus 55 plus 80?
20+35+40+55+60+55+80=345
55 plus Blank Eqoles 35?
55+(-20) equals 35
What time is 955 plus 75 minutes?
9:55 plus 75 minutes is 11:10.
What is 35 plus -20?
15
What is 80 plus 75 plus 35 equals?
190
What is the distributive property of 55 plus 35?
90
What is 20 plus x equals 55?
20 + x = 55x = 55 -20x= 35
What is 5 plus 5 times 5 plus 5?
100..55...35
What is 35 plus 40divided by 10x10?
35+40 divided by 10x10 is 0.75
What plus 35 equals 90?
X + 35 = 90, therefore X = 90 - 35, so X = 55.
Cosine 35 degrees sine 55 degrees plus sine 35 degrees cosine 55 degreees?
cos(35)sin(55)+sin(35)cos(55) If we rewrite this switching the first and second terms we get: sin(35)cos(55)+cos(35)sin(55) which is a more common form of the sin sum and difference formulas. Thus this is equal to sin(90) and sin(90)=1
What is 66 plus 55 plus 45 plus 35 plus 25 plus 15 plus 5?
simply do addition and your answer comes out to be 246
Trending Questions
Is it possible for a cow to give birth to one calf and after a week or so give birth to another calf?
Did the Paris peace treaties make World War 2 inevitable?
How old is Jerry Spinelli right now?
When did Pygmalion of tire die?
Why do cats get nasty?
The unit system used throughout most of the world is a metric system called the SI?
What did Methuselah do in The Bible?
How did America propaganda posters for world war 1 and world war 2 affected America culture?
What is the reaction formula for NH3 plus C6H5COOH?
Who were the choreographer of the song mehboba-mehboba from sholay?
My people dig a hole ... but they don't play in lawn I tried a lot .. but nothing I couldn't get it ... can someone help?
How many millimeters in 8 litters?
What is japans fastest car?
How do you install co2 cartridge in a daisy 1200 bb gun?
Who is Mpasua Msonobari?
Can humans take dog medications?
How do you get the spring in a Club Penguin mission?
Was Cleopatra living during time of christ?
What is an equation you can get 24 with by using the number 6 4 and 3 no exponents may be used you may only add subtract multiply or divide please help?
How did the resolutions at Potsdam set the stage for USSR and the U.S. to have tense relations after the war?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.