0
What else can I help you with?
Related Questions
What is 20 plus 35 plus 40 plus 55 plus 60 plus 55 plus 80?
20+35+40+55+60+55+80=345
55 plus Blank Eqoles 35?
55+(-20) equals 35
What time is 955 plus 75 minutes?
9:55 plus 75 minutes is 11:10.
What is 35 plus -20?
15
What is 80 plus 75 plus 35 equals?
190
What is the distributive property of 55 plus 35?
90
What is 20 plus x equals 55?
20 + x = 55x = 55 -20x= 35
What is 5 plus 5 times 5 plus 5?
100..55...35
What is 35 plus 40divided by 10x10?
35+40 divided by 10x10 is 0.75
What plus 35 equals 90?
X + 35 = 90, therefore X = 90 - 35, so X = 55.
Cosine 35 degrees sine 55 degrees plus sine 35 degrees cosine 55 degreees?
cos(35)sin(55)+sin(35)cos(55) If we rewrite this switching the first and second terms we get: sin(35)cos(55)+cos(35)sin(55) which is a more common form of the sin sum and difference formulas. Thus this is equal to sin(90) and sin(90)=1
What is 66 plus 55 plus 45 plus 35 plus 25 plus 15 plus 5?
simply do addition and your answer comes out to be 246
Trending Questions
Do accountants have job security?
Who cleans Bruno's wound?
Does the alveoli have smooth muscle?
When checking a sprinkler system a security officer should do what?
How does gulliver describe laputa and its people what does swift satire through it?
What is solid face in geometry?
What kind of tree produces blackberries?
How do you get the product code to Fallout New Vegas on PC if you don't have a case?
Is there a dowry required for the male of female to be given in marriage Who pays the dowry?
Why atmospheric nitrogen is heavier than chemical nitrogen?
When do you capitalize the word brigade?
Where is cipla plant in Sikkim?
Phone number for Imos corporate office in st Louis?
How did Nixon's trip change the US relationship with china?
How much is a speeding ticket going 89 in a 70 in Georgia?
How is ATP used during contraction and relaxation?
What is excration?
What is the First Folio?
Why did Emmett till trial failed?
What trust issues does Michael have in the movie The Blind Side?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.