0
What else can I help you with?
Related Questions
What is 20 plus 35 plus 40 plus 55 plus 60 plus 55 plus 80?
20+35+40+55+60+55+80=345
55 plus Blank Eqoles 35?
55+(-20) equals 35
What time is 955 plus 75 minutes?
9:55 plus 75 minutes is 11:10.
What is 35 plus -20?
15
What is 80 plus 75 plus 35 equals?
190
What is the distributive property of 55 plus 35?
90
What is 20 plus x equals 55?
20 + x = 55x = 55 -20x= 35
What is 5 plus 5 times 5 plus 5?
100..55...35
What is 35 plus 40divided by 10x10?
35+40 divided by 10x10 is 0.75
What plus 35 equals 90?
X + 35 = 90, therefore X = 90 - 35, so X = 55.
Cosine 35 degrees sine 55 degrees plus sine 35 degrees cosine 55 degreees?
cos(35)sin(55)+sin(35)cos(55) If we rewrite this switching the first and second terms we get: sin(35)cos(55)+cos(35)sin(55) which is a more common form of the sin sum and difference formulas. Thus this is equal to sin(90) and sin(90)=1
What is 66 plus 55 plus 45 plus 35 plus 25 plus 15 plus 5?
simply do addition and your answer comes out to be 246
Trending Questions
What are Naproxen ec 500mg tablets?
What are some of Caucasian traditions?
What is difference between for loop and while loop?
What are the qualities of a minor scale?
A girl writing an essay on what's her favorite hobby?
What nicknames does Robert Lee Perrill go by?
Description of the water cycle?
May hay while sun shines?
Who bore Abraham's first son?
How do you get ready for baby rabbits?
Where is the engine serial number on an xk8?
What is the substrate of carboxypeptidase?
What is the importance of angles shape and structure?
What two symbols are generally used in binary code?
I live in Colorado and I saw a large brown flying insect what is it?
Where is the glottis located?
Do chordates have a coelom?
Does deadweight loss exist in perfect competition?
What is the value of a 1979 Eire 2 Pence coin?
How long does it take for the fastest swimmer to swim the Olympic swimming pool?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.