0
What else can I help you with?
Related Questions
What is 20 plus 35 plus 40 plus 55 plus 60 plus 55 plus 80?
20+35+40+55+60+55+80=345
55 plus Blank Eqoles 35?
55+(-20) equals 35
What time is 955 plus 75 minutes?
9:55 plus 75 minutes is 11:10.
What is 35 plus -20?
15
What is 80 plus 75 plus 35 equals?
190
What is the distributive property of 55 plus 35?
90
What is 20 plus x equals 55?
20 + x = 55x = 55 -20x= 35
What is 5 plus 5 times 5 plus 5?
100..55...35
What is 35 plus 40divided by 10x10?
35+40 divided by 10x10 is 0.75
What plus 35 equals 90?
X + 35 = 90, therefore X = 90 - 35, so X = 55.
Cosine 35 degrees sine 55 degrees plus sine 35 degrees cosine 55 degreees?
cos(35)sin(55)+sin(35)cos(55) If we rewrite this switching the first and second terms we get: sin(35)cos(55)+cos(35)sin(55) which is a more common form of the sin sum and difference formulas. Thus this is equal to sin(90) and sin(90)=1
What is 66 plus 55 plus 45 plus 35 plus 25 plus 15 plus 5?
simply do addition and your answer comes out to be 246
Trending Questions
How did Michelangelo impact world history?
Does a wirless network adapter pick up singnals from a mifi?
Where do you get a thunder stone in Pokemon Gold?
What is a reaction progress curve?
What is the explanation for the U.S. declaration of war on Germany in April of 1917?
When was CARICOM set up?
If your Canadian license is suspended in Virginia does that affect your driving in Canada?
How do you flush the radiator for a 2003 Chevy Blazer?
Who were allowed to be actors in greek theatre?
How much do toy poodles eat?
How did people help stop the slave trade?
When you are driving in a bad weather or bad road condition you should?
What are CDKL5 disorders?
Is Whmis is part of the iso 14000 system?
A reader of fiction has to do more interpretation than a reader of a newspaper article because fiction writers?
Is increased cervical mucus an early pregnancy sign?
What is 1.199074074 rounded to the nearest tenth?
How much are bees worth these days?
What are the six functions of a dollar?
What does 150 ml of water look like?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.