0
What else can I help you with?
Related Questions
What is 20 plus 35 plus 40 plus 55 plus 60 plus 55 plus 80?
20+35+40+55+60+55+80=345
55 plus Blank Eqoles 35?
55+(-20) equals 35
What time is 955 plus 75 minutes?
9:55 plus 75 minutes is 11:10.
What is 35 plus -20?
15
What is 80 plus 75 plus 35 equals?
190
What is the distributive property of 55 plus 35?
90
What is 20 plus x equals 55?
20 + x = 55x = 55 -20x= 35
What is 5 plus 5 times 5 plus 5?
100..55...35
What is 35 plus 40divided by 10x10?
35+40 divided by 10x10 is 0.75
What plus 35 equals 90?
X + 35 = 90, therefore X = 90 - 35, so X = 55.
Cosine 35 degrees sine 55 degrees plus sine 35 degrees cosine 55 degreees?
cos(35)sin(55)+sin(35)cos(55) If we rewrite this switching the first and second terms we get: sin(35)cos(55)+cos(35)sin(55) which is a more common form of the sin sum and difference formulas. Thus this is equal to sin(90) and sin(90)=1
What is 66 plus 55 plus 45 plus 35 plus 25 plus 15 plus 5?
simply do addition and your answer comes out to be 246
Trending Questions
What is the abbreviaton of interjection using the shurley method?
What is distance time graph?
How many times does 4 go into 405?
What is the value of a marlin limited edition?
Who invented the master key?
What is the name of the song that was played on an episode of family matters of ziggy Marley?
What car did the scorpions drive in the movie grease?
What does the word root salping mean?
Driving miles Chicago to Pittsburgh pa?
How fast does a red maple tree grow?
What is the standard procedure for dividing by a two-digit divisor?
What is the name given to the protein molecule when is consists of a basic polypeptide chain?
What species of fish can be found in the Dead Sea?
Can you cure cancer through nanotechnology?
Was the Domesday book accurate?
What monkeys look like?
What are the 7 ingredients of civilization?
In which state is the university LA Tech?
What are the key differences between molecular and cellular biology?
What are the commands on godzhell?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.