0
cobalt sulfide
Wiki User
∙ 13y ago
Add your answer:
Earn +20 pts
What is cos square?
Cos times Cos
Cos plus cos plus cos?
3cos
Cos x - cos x sin2 x equals cos3x?
cos(x)-cos(x)sin2(x)=[cos(x)][1-sin2(x)]cos(x)-cos(x)sin2(x)=[cos(x)][cos2(x)]cos(x)-cos(x)sin2(x)=cos3(x)
How do you prove this trigonometric relationship sin3A equals 3sinA cos 2 A - sin 3 A?
sin(3A) = sin(2A + A) = sin(2A)*cos(A) + cos(2A)*sin(A)= sin(A+A)*cos(A) + cos(A+A)*sin(A) = 2*sin(A)*cos(A)*cos(A) + {cos^2(A) - sin^2(A)}*sin(A) = 2*sin(A)*cos^2(A) + sin(a)*cos^2(A) - sin^3(A) = 3*sin(A)*cos^2(A) - sin^3(A)
How do I find the product z1z2 if z1 5(cos20 plus isin20) and z2 8(cos15 plus isin15)?
Like normal expansion of brackets, along with: cos(A + B) = cos A cos B - sin A sin B sin(A + B) = sin A cos B + cos A sin B 5(cos 20 + i sin 20) × 8(cos 15 + i sin 15) = 5×8 × (cos 20 + i sin 20)(cos 15 + i sin 15) = 40(cos 20 cos 15 + i sin 15 cos 20 + i cos 15 sin 20 + i² sin 20 sin 15) = 40(cos 20 cos 15 - sin 20 cos 15 + i(sin 15 cos 20 + cos 15 sin 20)) = 40(cos(20 +15) + i sin(15 + 20)) = 40(cos 35 + i sin 35)
What does CoS stand for in chemistry?
CoS is the chemical formula of a possible cobalt sulfide.
How much money does forensic voice analyst earn?
how much do lab analysts earn.still a student and would like to know cos im doing B.s.c in chemistry how much do lab analysts earn.still a student and would like to know cos im doing B.s.c in chemistry
What is the best name for NaBr2?
NaBr2 is a chemistry related word meaning Sodium Bromide? Try Improve your answer cos it makes no sense to me....
What is cos square?
Cos times Cos
Is cos squared x the same as cos x squared?
No. Cos squared x is not the same as cos x squared. Cos squared x means cos (x) times cos (x) Cos x squared means cos (x squared)
Cos plus cos plus cos?
3cos
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
cos i?
cos i
Cos x - cos x sin2 x equals cos3x?
cos(x)-cos(x)sin2(x)=[cos(x)][1-sin2(x)]cos(x)-cos(x)sin2(x)=[cos(x)][cos2(x)]cos(x)-cos(x)sin2(x)=cos3(x)
Verify that sin minus cos plus 1 divided by sin plus cos subtract 1 equals sin plus 1 divided by cos?
[sin - cos + 1]/[sin + cos - 1] = [sin + 1]/cosiff [sin - cos + 1]*cos = [sin + 1]*[sin + cos - 1]iff sin*cos - cos^2 + cos = sin^2 + sin*cos - sin + sin + cos - 1iff -cos^2 = sin^2 - 11 = sin^2 + cos^2, which is true,
What is cos 495 degree's?
cos(495) = cos(495-360) = cos(135) = -cos(180-135) = -cos(45) = -sqrt(1/2) or -1/sqrt(2)
What is cos of a negative angle?
The cosine function is an even function which means that cos(-x) = cos(x). So, if cos of an angle is positive, then the cos of the negative of that angle is positive and if cos of an angle is negative, then the cos of the negative of that angle is negaitive.
