This should be SO4-2 ion. sulfur shows +6 in this ion.
This should be SO4-2 ion. sulfur shows +6 in this ion.
zn is equal to +2 and so4 is equal to -2. those are the oxidation numbers. dont worry its correct
Oxygen atoms are generally considered to have an oxidation number of -2 in all oxyanions such as sulfate.
+6: Oxygen in oxyanions is assumed to have an oxidation state of -2; there are four such oxygen atoms, for a total of -8, and the SO4 anion has a charge of -2. This means that the sulfur atom must have an oxidation state of +6, because +6 added to - 8 = -2.
+3 for Al and -2 for O is the oxidation number for Al2O3.
This should be SO4-2 ion. sulfur shows +6 in this ion.
zn is equal to +2 and so4 is equal to -2. those are the oxidation numbers. dont worry its correct
Oxygen atoms are generally considered to have an oxidation number of -2 in all oxyanions such as sulfate.
SO4^2- has a net negative 2 charge.each O = 2-S = 6+
+6: Oxygen in oxyanions is assumed to have an oxidation state of -2; there are four such oxygen atoms, for a total of -8, and the SO4 anion has a charge of -2. This means that the sulfur atom must have an oxidation state of +6, because +6 added to - 8 = -2.
k2cr2o7+FeSO4+H2SO4 --> Cr2(SO4)3+Fe2(SO4)3+K2SO4+H2O
+3 for Al and -2 for O is the oxidation number for Al2O3.
Chromium is a useful element. It shows +2 in this compound.
The oxidation numbers in PO43- , phosphorus oxidation number=+5; oxygen = -2
There are two oxidation numbers. P shows +5 oxidation number.
It shows some oxidation numbers. Generally it shows +4 oxidation numbers.
Aluminium is a light metal. Al shows +3 in aluminium sulfate.