0
What else can I help you with?
Related Questions
What is the gcf of 126 and 378?
The GCF is 126.
What is the GCF of 6384and 126?
The GCF of 63, 84 and 126 is 21. The GCF of 6384 and 126 is 42.
Kate asked people if they read the daily newspaper 80 people said no and 126 said yes What are the correct percentages?
80 + 126 = 206 80 / 206 ≈ 38.8% 126 / 206 ≈ 61.2%
What is the gcf of 126 and 154?
The GCF is 14.
What is the GCF of 18 and 126?
The GCF is 18.
What is the greatest common factor of 126 90 and 54?
The GCF of 54, 90, and 126 is 9
What is the GCF of 340 126?
The GCF of 340, 126 is 2.
What is the GCF of 99 and 126?
The GCF of 99 and 126 is 9.
What is the gcf of 126 and 4?
The GCF of 126 and 4 is 2.
What is the GCF of 210 and 126?
The GCF for 210 126 is 42.
What is the the GCF of 126 and 100?
GCF(126, 100) = 2.
What is the gcf of 42 and 63 and 126?
The GCF is 21.
Trending Questions
What is the prim factorization of 12?
Do Komodo dragons shed their skin or scales?
What zooogist do on a daily basis?
Is cod4 console commands a mod?
What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl?
What are disadvantages of silverfish and army ants?
What was the hill called where the battle of bunker hill was fought?
World dawn how do you get party Digimon to go in your digifarm?
What are three pressures on Legislators?
How can on be a professor?
Is there something like cheat engine?
How far is it from San Antonio TX to Kerrville TX?
What are some good Planet Fitness workouts for beginners?
What is Constellation of a dog?
What is the major scale chord formula and how can it be applied in music theory?
What can you profit from a terebinth tree?
How do you answer this question in spanish cauntas personas hay en su familia?
What should be included in a resignation letter?
What is the comparative or superlative of flat?
How does a human seek shelter?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.