0
120o. The polyatomic ion is planar with a trigonal molecular geometry, a nitrogen atom with 3 equidistant O atoms at near 122 pm. All predictable ny VSEPR. The short bond length is attributed to pi bonding, the negative charge is spread across the three O atoms.
Wiki User
∙ 11y ago
Add your answer:
Earn +20 pts
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the number of moles in 132g Ba NO3 2?
Ba(NO3)2The total mass for this molecule is 261gso what is 261g/132g this is 1.97moles
What is the reaction equation for Pb NO3 2 plus KI?
yhujuhj
What does nitrat oxidate number?
The oxidation number of nitrogen in the nitrate ion NO3- is 5
Is 60 a cube number?
no3³ = 274³ = 64if it is then somewhere between 3 and 4
What are the resonance structures and molecular polarity of No3?
Ignore the placement of the periods, they are to space the models.Lines (\, /, |) represent bonds:O.....O.\\.../....N-...|....OO.....O..\..//....N-...|....OO.....O..\.../....N........OEach bond is distanced by a 120º angle.
Write the electronic and molecular geometry of NO3- and xeF2?
Trigonal Planar Electronic Geometry Geometry of Molecules: Trigonal Planar Three oxygen atoms are joined to the nitrogen atom in the NO3- ion to create a center atom. The configuration is trigonal planar, and the three oxygen atoms' bonds to the nitrogen atom have roughly 120-degree angles.
What is the electronic geometry of bi3?
What is the electronic geometry of Bi_3? Enter the ... Thus, the total number of electrons in the molecule will be 24. There are no lone pairs in boron. Three electron domains are thus present in this molecule. Therefore, the electronic geometry of B I 3 is trigonal planar.
Is Fe(NO3)2 Ionic or molecular?
Fe(NO3)2 is an ionic compound.
How do you bond CA 2 WITH NO3 1- in chemistry?
We need two NO3- to cancel out Na2+: Ca(NO3)2.
Is no3 ionic or molecular?
Lead nitrate is an ionic compound.
What is the correct molecular shape for no3?
trigonal planar
Is NO3 a covalent bond?
NO3 is a nitrate ion. Yes, the nitrogen and the oxygen atoms in NO3 are bonded together by covalent bonds.
What is the molecular formula for gold nitrate?
Formula: Au(NO3)3
What type of bond is NH4NO3?
ionic bond as it contain two ion NH4+ and NO3-. NH4+ as it contain covalent bond between N and H. Also in NO3- oxygen bound by one covalent bond and one partial bond to each oxygen.
What is the chemical formula for cobalt II nitrate?
The molecular formula is Co(NO3)2Co(NO3)2
Is beryllium nitride a molecular or ionic?
Covalent. Be is highly electronegative to form ionic bonds.
