0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the correct structure of 3-3-dimethylhexane?
H3c h3c ch3 ch3
Why structure expressions in different ways?
The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.
What do you call a pyramid with a square at the bottom?
A pyramid is a structure with a square at the bottom and 4 triangles connecting them. You have the correct word.
Is 678 divisibility by 3 correct?
678 is divisible by 3.
3 examples of a surface structure?
walmart and kmart
What is the correct structure of 3-3-dimethylhexane?
H3c h3c ch3 ch3
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
How can you check and correct your Lewis structure?
Although Excel checks that the formula has the correct structure, it does not check that the formula contains the correct values or cell references.
Is the correct structure disappointed by or with?
Disappointed with is correct, but I am not sure about disappointes by. sorry
What structure does copper have?
I would say Un Sacapuntas is the correct structure of copper
What is the correct Lewis structure for chloroform?
CHCL3
What is the correct structure for ammonia NH3?
C plato
If the sentence to be is a correct sentence what is its meaning?
It means it must be grammatically correct. The word spellings and the structure should be correct too.
The correct Lewis structure for the oxygen atom has?
The correct Lewis Structure for the oxygen atom will be an 'O' with two dots above and below, with one dot on the left and on the right sides.
How do you spell sisturn?
The correct spelling is cistern (a rainwater collection and storage structure).
Why structure expressions in different ways?
The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.
How do you spell skelataon?
The correct spelling is "skeleton" (a structure of bones).
