0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
How do you balance Pbo plus C equals Pb plus CO2?
2 PbO + C -> 2 Pb + CO2
Point b is the midpoint of the sequence pq the sequence pq is eight cm longer than the sequence pb what is the number of cm in the length of the sequence qb?
The whole sequence (pq) = pb + 8. b is the midpoint so pb = 1/2pq, making pb = 8 and bq also 8 cm
What does a punet square look like with a cross of PpBbWw and PpBbWw?
PP Pp PB Pb PW Pw pP pp pB pb pW pw BP Bp BB Bb BW Bw bP bp bB bb bW bw WP Wp WB Wb WW Ww wP wp wB wb wW ww
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the reaction equation for Pb NO3 2 plus KI?
yhujuhj
How do you beat a PB when you have passed your peak?
When you've passed your peak the main things you are missing are strength and stamina therefore the only way you'll improve your PB is through improvement in technique or equipment
What does peanut butter go best with?
Cellery and PB PB & Jelly Chocolate and PB
What does the acronym PB stand for?
In the Penetrant PB B'laster, the PB stands for Penetrating B'laster.
Why do you have to write Pb instead of PB?
because if you were to write PB then it would be a compound not a single element while Pb is lead.
Is Pb a element or compound?
Pb is a compound.
What is the Atomic Symbol for Lead?
Pb , derived from Plumbum.
What is PB ZN?
Pb = Lead ZN = Zinc
What is 0.65 moles of lead?
That is equal to 0.65 (mol Pb) * 207.2 (g/mol Pb) = 135 grams Pb 207.2 = molar mass of Pb, lead.
What does the symbol Pb stands for?
The chemical symbol Pb stands for "lead", Plum bum.
What element does Pb stand for in the periodic table?
Pb
What symbol for lead?
Symbol: Pb make sure you so capital P and lower case b
How protons does Pb have?
Lead or Pb ALWAYS has 82 protons.
