0
What else can I help you with?
Related Questions
What is 8×5?
40
What is 36 plus 35 plus 40 plus 40 plus 40 plus 40 plus 40 equals?
36 + 35 + 40 + 40 + 40 + 40 + 40 = 271 271 is the answer
what times 25 equals 1000?
40
How do you figure what is 40 percent of 250000?
40% = 40/100So 40% of 250,000 = 250,000*40/100 = 100,00040% = 40/100So 40% of 250,000 = 250,000*40/100 = 100,00040% = 40/100So 40% of 250,000 = 250,000*40/100 = 100,00040% = 40/100So 40% of 250,000 = 250,000*40/100 = 100,000
How do you find 45 of 40 in math?
45 of 40 = 45*40 = 180045 of 40 = 45*40 = 180045 of 40 = 45*40 = 180045 of 40 = 45*40 = 1800
What is the LCM for 20 and 40?
40.(40/40 = 1)(40/20 = 2)
what is 8x5?
40
What is 39 rounded to the nearest ten?
40
How many factors does 40 have?
40,=1,2,4,5,8,10,20 AND 40
What does 5x8 equals?
40
What is 2 thirds of 60 full answer?
It is 40.It is 40.It is 40.It is 40.
60+what=100?
answer is:- 40
Trending Questions
Who does Charmander evolve into?
Where can you get the T shirt Jamie Redknapp was wearing on the gameshow a league of there own. It was blue with a red number with a white tiger on?
What does no chiz mean when the icarly cast uses it in a sentence?
What do we assume happens to Beth at the end of Repo Men when Jake says he will take care of her?
Sino ang may akda ng amaterasu?
Is Michele Bachmann Jewish?
What is Molecular mass of CH3(CH2)11(OCH2CH2)nOSO3Na?
What is a claim for the book Holes by Louis Sachar?
Who created the TV series Sledge Hammer?
What song does rascal flatts sing that has the girl with cancer?
What is the scientific name or taxonomic classification of the poisonous plant Red Buckeye?
How long should patients feet soak?
Who makes the Xbox?
Hiring jobs for a 16 year old in Saginaw Michigan?
What is real life system?
Why the ''wearin of the green''?
How do you pronoune selah?
Who influenced lucian Freud?
What is a girl child called?
How many grams are needed to have 5.00 moles?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.