0
A C5H12
What else can I help you with?
What is the melting point of solid wax C20H42?
The melting point of icosane (C20H42) is 36-38 0C.
Is C20H42 organic or inorganic?
organic molecule
What is the chemical formula for Eicosane?
Eicosane (now spelled without the e) has the formula C20H42.
What is Iodine solid wax brass argon KCl ranked from lowest melting point to highest?
1. Argon 2. Solid Wax (C20H42) 3. Iodine 4. KCl 5. Brass
How many hydrogens in eicosane?
Eicosane is a straight-chain alkane with the chemical formula C20H42. This means it contains 20 carbon atoms and 42 hydrogen atoms. Therefore, eicosane has 42 hydrogen atoms in total.
Rank the following substances from lowest to highest melting point Please note that ionic substances melt at higher temperatures than metallic substances and metals melt at higher temperatures than m?
Helium Neon Argon Chlorine Naphthalene (C10H8) Iodine Bromine Solid paraffin (C28H58) KCl Solid wax (C20H42) RbBr CsI Brass Quartz Diamond ------- Argon Solid Was (C20H42) Iodine KCI Brass
What is name of C20H44?
The highest possible hydrogen count on Cn-hydrocarbons is (2n+2), so here it would be correctly stated as (saturated alkane) C20H42 which is called icosane(icosa: meaning 20).C20H44 is not a possible formula, so there is no need to name it.
What mass is the of 4.52 x 10-3 moles of C20H42?
There are two types and many other isomers of C20H42(wikipedia citation "It has 366,319"; all of them have different physical properties)1.n-Icosane (alternative spelling eicosane) Density of the UNbranched n-icosane: 932 mg mL−1 (at 20 °C)Molecular formula CH3(CH2)18CH32. IUPAC name: 2,6,10,14-Tetramethylhexadecane. Density 791 mg mL−1 (at 20 °C).Molecular formula: CH3CH(CH3)CH2CH2-(CH2CH(CH3)CH2CH2)-(CH2CH(CH3)CH2CH2)-CH2CH(CH3)CH2CH3
What is C20 H42?
C20H42 is a chemical compound known as eicosane, which is an alkane with a straight-chain structure consisting of 20 carbon atoms and 42 hydrogen atoms. It is a waxy solid at room temperature and is commonly found in various natural sources, including certain plants and the cuticles of some insects. Eicosane is often used in laboratories and industries for applications such as lubricants and as a standard in the study of hydrocarbons.
Why eicosane a solid at room temperature?
Eicosane is a solid at room temperature because it has a high melting point due to its strong intermolecular forces, specifically van der Waals forces. These forces hold the eicosane molecules together in a rigid, organized structure, preventing them from moving freely and maintaining a solid state at room temperature.
What is the appropriate reaction equation for a burning candle?
Most candles contain more than one compound, but a typical example for a paraffin candle would be 2 C20H42 + 61 O2 => 40 CO2 + 42 H2O.
Which is a hydrocarbon?
They can be any one of the three under normal conditions, it depends on the molecular weight. Lighter ones such as methane, ethane ethene, ethyne are gases. Pentane hexane and heavier up to around C19 are liquids. High molecular weight hydrocarbons above say C20H42 are waxes.
