-1
If you aren't able to type 33, use 3^3
A triangle has 3 sides
axa=answer
an equilateral triangle
It is an equilateral triangle that has 3 congruent sides
Isomer's
Yes, 3-octene can exhibit cis-trans isomerism. In the cis isomer, the two methyl groups are on the same side of the double bond, while in the trans isomer, they are on opposite sides.
Yes, 3-hexene can exist as cis-3-hexene and trans-3-hexene isomers. In the cis isomer, the two alkyl groups are on the same side of the double bond, while in the trans isomer, they are on opposite sides.
The trans isomer of potassium dioxalatodiaquachromate (III) is prepared by treating the cis isomer with ammonia gas in a concentrated ammonia solution. The chemical equation for the preparation is: Cr(C2O4)(H2O)2(NH3)2 + NH3 → Cr(C2O4)(H2O)2(NH3) + H2O + NH4NO3
This could be termed as "3-heptene" or "hept-3-ene". Depending on the geometric isomers you could add the prefix cis or trans. If the 2 H atoms are on one side and the hydrocarbon chain on the other side, then it is the cis isomer. If the groups are on either sides , then it is the trans isomer.
A benzvalene is a highly reactive tricyclic unsaturated hydrocarbon, tricyclo[3.1-0.02,6]hex-3-ene, which is a valence isomer of benzene.
One isomer of a ketone with the formula C5H10O is 2-pentanone, also known as methyl propyl ketone.
isomer, insolent, Italian, insolvent, indigent, impala, isolate, isobar, intention, ibises, inculcate, Iowa, incubus, iodine, irises, icicle, iconic...
type a < and then type a 3 <3
Type 3
You type it like this: 250^3
CH3CH2CH2CH(CH3)CH2CH2CH3 CH3(CH2)4CH(CH3)CH2CH3