0
-1
Chad Rath
Add your answer:
Earn +20 pts
How do you type a cubed number on a keyboard?
If you aren't able to type 33, use 3^3
What type of shape has exaclty 3 sides?
A triangle has 3 sides
How to type square root 3?
axa=answer
What is the difference between pi and the number three?
pi is a transcendental (a special type of irrational) number whereas 3 is not only rational, but an integer.pi is a transcendental (a special type of irrational) number whereas 3 is not only rational, but an integer.pi is a transcendental (a special type of irrational) number whereas 3 is not only rational, but an integer.pi is a transcendental (a special type of irrational) number whereas 3 is not only rational, but an integer.
What is a Type of triangle with 3 congruent sides?
It is an equilateral triangle that has 3 congruent sides
What are compounds with the same simple formula but different 3-dimensional structures called?
Isomer's
Does 3-hexene have cis and trans isomers?
Yes, 3-hexene can exist as cis-3-hexene and trans-3-hexene isomers. In the cis isomer, the two alkyl groups are on the same side of the double bond, while in the trans isomer, they are on opposite sides.
What is the Chemical equation of Preparation of trans isomer of potassium dioxalatodiaquachromate 3?
The trans isomer of potassium dioxalatodiaquachromate (III) is prepared by treating the cis isomer with ammonia gas in a concentrated ammonia solution. The chemical equation for the preparation is: Cr(C2O4)(H2O)2(NH3)2 + NH3 → Cr(C2O4)(H2O)2(NH3) + H2O + NH4NO3
What is the nomenclature for ch3-ch2-chch-ch2-ch2-ch3?
This could be termed as "3-heptene" or "hept-3-ene". Depending on the geometric isomers you could add the prefix cis or trans. If the 2 H atoms are on one side and the hydrocarbon chain on the other side, then it is the cis isomer. If the groups are on either sides , then it is the trans isomer.
What is a benzvalene?
A benzvalene is a highly reactive tricyclic unsaturated hydrocarbon, tricyclo[3.1-0.02,6]hex-3-ene, which is a valence isomer of benzene.
Isomer of ketone with formula C5H10O?
One isomer of a ketone with the formula C5H10O is 2-pentanone, also known as methyl propyl ketone.
What are examples of 3 syllable words beginning with I?
isomer, insolent, Italian, insolvent, indigent, impala, isolate, isobar, intention, ibises, inculcate, Iowa, incubus, iodine, irises, icicle, iconic...
How can you type hearts?
type a < and then type a 3 <3
Which type of incident require resources that exceed the intitial response and include aircraft crashes and hostage situations?
Type 3
How do i type 250 to the power of 3?
You type it like this: 250^3
What are some eight letter words with 1st letter C and 6th letter A and 7th letter N and 8th letter E?
According to SOWPODS (the combination of Scrabble dictionaries used around the world) there are 3 words with the pattern C----ANE. That is, eight letter words with 1st letter C and 6th letter A and 7th letter N and 8th letter E. In alphabetical order, they are: camphane camstane catenane
Write condensed structures for 3-ethylhexane?
CH3CH2CH2CH(CH3)CH2CH2CH3 CH3(CH2)4CH(CH3)CH2CH3
