0
Add your answer:
Earn +20 pts
What is the sin of pie over 2?
1
What is sin A equals 7 over 25?
It is a trigonometric equation. A = sin-1(7/25) = 0.284 radians.
What is the exact value of the expression cos 7pi over 12 cos pi over 6 -sin 7pi over 12 sin pi over 6?
cos(a)cos(b)-sin(a)sin(b)=cos(a+b) a=7pi/12 and b=pi/6 a+b = 7pi/12 + pi/6 = 7pi/12 + 2pi/12 = 9pi/12 We want to find cos(9pi/12) cos(9pi/12) = cos(3pi/4) cos(3pi/4)= cos(pi-pi/4) cos(pi)cos(pi/4)-sin(pi)sin(pi/4) cos(pi)=-1 sin(pi)=0 cos(pi/4) = √2/2 sin(pi/4) =√2/2 cos(pi)cos(pi/4)-sin(pi)sin(pi/4) = - cos(pi/4) = -√2/2
What is the perimeter of a triangle when its longest side is 162 mm with two of its angles being 37.25 degrees and 48.4 degrees?
Using the sine rule you can find the other two sides: Final angle = 180° - (37.25° + 48.4°) = 94.35° → other two sides are opposite the 37.25° and 48.4° angles as the longest side is opposite the largest angle. → the other two sides are: s1/sin 37.25° = 162mm / sin 94.35° → s1 = 162mm × sin 37.25°/sin 94.35° and s2 = 162mm × sin 48.4°/sin 94.35° → the perimeter = 162mm + 162mm × sin 37.25°/sin 94.35° + 162mm × sin 48.4°/sin 94.35° = 162mm (1 + (sin 37.25° + sin 48.4°)/sin 94.35°) ≈ 382 mm
What is the value sin x if cos x equals 2 over sqrt 5?
It would be 1 over square root 5.
What does over zealous mean?
Overzealous means overly excited about something. someone who is overzealous is so fervent about something that he is possibly being ineffective, or hurting the very cause that he's zealous about.
Is over zealous one word?
Yes, as overzealous (too zealous). It cannot be two words.
Can you give me a sentence using the word zealous?
the over zealous cat kill the many mashed potato people of pompay the over zealous cat kill the many mashed potato people of pompay the over zealous cat kill the many mashed potato people of pompay the over zealous cat kill the many mashed potato people of pompay the over zealous cat kill the many mashed potato people of pompay He is eager to please his superiors, h is quite zelous and works till midnight.
What is Nancy famous for?
Nancy Hart is known for being a woman who participated in the Revolutionary war. After the war she became over religious and was known for here over zealous beliefs.
What was the Over zealous search for heretics especially in Spain and Italy?
the inquisition
How can you use zealous in a sentence?
He is a zealous reader of the series. (Zealous meaning avid)
What panic reaction lead to jerky steering and instability of your vehicle?
over-zealous
If being jealous is a sin and god is jealous does that make him a hyprocrit?
an OBVIOUS discrepancy. but no, sorry. sin jealous is wanting something so much that you don't have that you hate the person who has it. god jealous is loving us so much he wants us to be with him. anyways we are rightfully his as his creation. its also translated as "zealous". people are zealous for god because he is jealous for us. like a husband: he wouldn't say, yes wife, go be happy with whoever and do whatever! He would love her and protect her and keep her and if she was taken away, he would be jealous for her.
How do you write the word zealous in a sentence?
"Her reaction to my proposal was overly zealous so I punched her in the face." or "Hello, I'm feeling very zealous today. I think I shall purchase an 'Auto-mobile'." or even "Julian was worryingly zealous when I jokingly suggested shooting Meredith for talking at the dinner table, despite being a woman, and a married one at that!"
What is an intention of a sin?
it is thinking over a sin. trying a sin. meaning to sin.
What is a Bible thumper?
A bible thumper is a Christian fundamentalist or over-zealous evangelical Christian.
What is some words that starts with a z that describes someones personality?
cool amazing wonderful beautiful fantastic gangsta
