0
What else can I help you with?
Related Questions
What shapes are a pyramids?
triangular pyramid
List names of 3D shapes?
Cubes, pyramids, cones, and spheres are all 3D shapes.
What geometric shape makes these structures pyramids?
Pyramids are constructed from triangular shapes and can have square or triangle bases
Why are population pyramids sometimes called age structure diagrams?
Because they loose their shapes like pyramids.
What shapes have 5 vertices and 8 edges?
Rectangular pyramids
What are four examples of triangular pyramid shapes in the world?
Pyramids
What geometric shape do Egypt pyramids look like?
Pyramid shapes
What types of shape are solid shapes what is the name for it?
Polyhedrons such as pyramids and cuboids
What kinds of 3d shapes are there?
There is prisms and pyramids. There are also spheres and cylinders
How are spheres and square pyramids alike and unalike?
There're are 3d shapes
What are examples of 3 dimensional shapes?
cubes, pyramids, prisms, spheres
What type of organism forms the base of a pyramid of numbers?
pyramids are shapes of numbers
Trending Questions
Are cars required to have airbags?
What species are negatively affected by aquaculture?
Did Gjack Donahue and Nicholas Berrugian Get Wealthy Together?
Is South Dakota a common noun?
How much volume in cubic feet?
Complete redox reaction under acid condition MnO4 H2O2?
How do stocks get their prices?
What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl?
What items are gross?
What are the purpose of liver enzymes?
What does a mi tampoco ver la tele mean in English?
What is kerosene in tagalog?
What are opinions to who is the best football player ever?
How many Indian doctors in us?
What are the disadvantages of car grounding wire?
Are elephant seals mammals?
What two latitude does the cross section represent in Asia?
What is the luster of curium?
What are the religions in the amazon river?
How to Replacing a water heater element?
Copyright ©2026 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.