0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What are five trigonometric identities?
All others can be derived from these and a little calculus: sin2x+cos2x=1 sec2x-tan2x=1 sin(a+b)=sin(a)cos(b)+sin(b)sin(a) cos(a+b)=cos(a)cos(b)-sin(a)sin(b) eix=cos(x)+i*sin(x)
What is the tangent formula in trig?
The Tangemt Formula for Geometry is opposite over adjacent, or opp./adj.
What is the formula for a 45 degree lateral on 6 inch weld pipe?
formula for a 6" 45 degree lateral onto a 6" main
Find the explicit formula for the sequence?
Type yourWhich choice is the explicit formula for the following geometric sequence? answer here...
What is the dimensional formula for couple?
M1 l2 t-2
What does tangent 2 x plus 1 equal?
tan(2x) = 2tanx/(1 - tan2x) So tan(2x) +1 = 2tanx/(1 - tan2x) + 1 = 2tanx/(1 - tan2x) + (1 - tan2x)/(1 - tan2x) = (-tan2x + 2tanx + 1)/(1 - tan2x)
What is the vertical asymptotes for tan2x?
there is non its an infinite line.
What is the range of y equals tan2x?
It depends on the domain of x.
How do you prove one - tan square x divided by one plus tan square xequal to cos two x?
(1 - tan2x)/(1 + tan2x) = (1 - sin2x/cos2x)/(1 + sin2x/cos2x) = (cos2x - sin2x)/(cos2x + sin2x) = (cos2x - sin2x)/1 = (cos2x - sin2x) = cos(2x)
How do you simplify tanx plus 1 sqaured?
I assume you mean (tanx+1)^2 In which case, (tanx+1)^2=tan2x+2tanx+1
What is the period of y equals tan2x?
The period of the tangent function is PI. The period of y= tan(2x) is PI over the coefficient of x = PI/2
What is the answer to cot squared x - tan squared x equals 0?
cot2x-tan2x=(cot x -tan x)(cot x + tan x) =0 so either cot x - tan x = 0 or cot x + tan x =0 1) cot x = tan x => 1 / tan x = tan x => tan2x = 1 => tan x = 1 ou tan x = -1 x = pi/4 or x = -pi /4 2) cot x + tan x =0 => 1 / tan x = -tan x => tan2x = -1 if you know about complex number then infinity is the solution to this equation, if not there's no solution in real numbers.
What is the answer to 2 tan 4x-tan2x-15 equals 0?
It is more than likely that the 4x and 2x do not refer to quadruple and double angles but to the powers of tan. However, given the limitations of the browser it is impossible to be sure.
What are five trigonometric identities?
All others can be derived from these and a little calculus: sin2x+cos2x=1 sec2x-tan2x=1 sin(a+b)=sin(a)cos(b)+sin(b)sin(a) cos(a+b)=cos(a)cos(b)-sin(a)sin(b) eix=cos(x)+i*sin(x)
C2H2 is a chemical formula for acetylene. Which type of chemical formula is this A molecular formula An empirical formula A structural formula?
the answer is : A MOLECULAR FORMULA
What is the chemical formula for calcium metal?
What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?
Formula for hypochlorite?
Formula: HClO
