0
Add your answer:
Earn +20 pts
What is the coefficient in algebra?
The coefficient in algebra is the number before a letter with an exponent on it. The 3 is the coefficient in this example: 3x7
What is the coefficient in the algebraic expression 6n 3?
The coefficient in an expression is the multiplier of the variable in the equation. Here, the coefficient would be 6.
What is the coefficient in this algebraic expression 6n plus 3?
6 is the coefficient of n in this expression.
What is the coefficient of the x2y term in the expansion of (x plus 2y)3?
The coefficient is 6.
How do you write the numerical coefficient of 3axy?
It is 3.
When this equation is balanced what is the coefficient for Ni NO3 3?
The coefficient for Ni(NO3)2 in the balanced equation depends on the overall reaction. Without knowing the full equation, it is not possible to determine the coefficient for Ni(NO3)2.
When this equation is balanced what is the coefficient for ni (no.3) 3?
The coefficient for Ni NO3 3 is four.
When this equation is balanced what is the coefficient for ni(no3)3. ni(no3)3 plus pbbr4 -- and gt nibr3 plus pb(no3)4?
Your formulas are not correct.
What is the coefficient for ni (no3)4?
4
What coefficient does Al NO3 3 have in the balanced equation?
The coefficient for Al(NO3)3 is 2 in the balanced equation. For example, in the equation: 2Al + 3Cu(NO3)2 → 2Al(NO3)3 + 3Cu Al(NO3)3 has a coefficient of 2.
What coefficient does AI(NO3)3 have in the balanced equation?
The balanced equation for AI(NO3)3 is not provided, but in a typical chemical equation, the coefficient for AI(NO3)3 would be 1.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What coefficient does Al(NO3)3 have in the balanced equation?
2
What is the Chemical Formula for Nickel III Nitrate?
The chemical formula for Nickel III nitrate is Ni(NO3)3.
Finish balancing the following equation Al(s) plus 3Zn(NO3)2(aq) Al(NO3)3(aq) plus Zn(s) What coefficient does Al(s) have in the balanced equation?
the answer is 2 apex
What is the formula for nickel I nitrite?
Ni+1 NO2-1
Gold III nitrate?
Gold(III) nitrate is a chemical compound with the formula Au(NO3)3. It is a yellow, crystalline solid that is highly toxic and can decompose explosively when heated. Gold(III) nitrate is primarily used in research laboratories for various chemical reactions and is not commonly found in commercial applications.
