0
Add your answer:
Earn +20 pts
What does pb plus 2 mean in chemistry?
An atom of lead that has bee stripped of two of its electrons.
How do you balance Pbo plus C equals Pb plus CO2?
2 PbO + C -> 2 Pb + CO2
Point b is the midpoint of the sequence pq the sequence pq is eight cm longer than the sequence pb what is the number of cm in the length of the sequence qb?
The whole sequence (pq) = pb + 8. b is the midpoint so pb = 1/2pq, making pb = 8 and bq also 8 cm
What does a punet square look like with a cross of PpBbWw and PpBbWw?
PP Pp PB Pb PW Pw pP pp pB pb pW pw BP Bp BB Bb BW Bw bP bp bB bb bW bw WP Wp WB Wb WW Ww wP wp wB wb wW ww
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What does pb mean for cars?
In the context of cars, "PB" most likely refers to "Park Brake," which is another term for the parking brake or handbrake. This brake is used to prevent the vehicle from moving when parked.
What does PB mean in computer terms?
PB = PetaByte = 2 to the 50th = 1,125,899,906,842,624 bytes
What does PB mark on jewelry mean?
The "PB" is probably the manufacturer, The manufacturer is most likely Paul Brackna (PB), who is a master goldsmith and jewelry designer.
What does PB mean in baseball?
Passed ball.
What is the meaning of the word in chemistry pb?
In chemistry, Pb is the chemical symbol for lead. Lead is a heavy metal element with the atomic number 82. It is commonly used in batteries, construction materials, and as a shield against radiation.
What does PB mean in a case number?
peanut butter
What is the balanced equation for the reaction of nitric acid on lead?
if you mean lead the metal: Pb + 2H+ --> Pb+2 + H2
Why does pd stand for lead?
You mean Pb? It comes from the Latin for lead, plumbum.
What does the Y Pb Pr cables do and mean?
What do the Y and Pb and Pr cables do and mean?What the Cables Do and Mean. Y=Green/sync, Pb=blue, Pr = red. These are video cables where the colors have been separated into it basic Green, Blue and Red signals. Makes it easier for the digital... Read More
What does this ditloid mean 10 pb?
10 Pin Bowling
What does you love pb mean?
"Love pb" could mean "love peanut butter" or "love private message" depending on the context it is used in.
What does PB sample mean in medical terminology?
Pb is the chemical abbreviation for lead, so perhaps it refers to a sample taken for lead level testing.
