Performance bond
A surety bond between two parties, insuring one party against loss if the terms of a contract are not fulfilled. Usually part of a construction contract or supply agreement.
Wiki User
∙ 15y agoAn atom of lead that has bee stripped of two of its electrons.
2 PbO + C -> 2 Pb + CO2
The whole sequence (pq) = pb + 8. b is the midpoint so pb = 1/2pq, making pb = 8 and bq also 8 cm
PP Pp PB Pb PW Pw pP pp pB pb pW pw BP Bp BB Bb BW Bw bP bp bB bb bW bw WP Wp WB Wb WW Ww wP wp wB wb wW ww
NI(NO3)3+pbbr4nibr3+pb(no3)4
In the context of cars, "PB" most likely refers to "Park Brake," which is another term for the parking brake or handbrake. This brake is used to prevent the vehicle from moving when parked.
PB = PetaByte = 2 to the 50th = 1,125,899,906,842,624 bytes
The "PB" is probably the manufacturer, The manufacturer is most likely Paul Brackna (PB), who is a master goldsmith and jewelry designer.
Passed ball.
peanut butter
In chemistry, Pb is the chemical symbol for lead. Lead is a heavy metal element with the atomic number 82. It is commonly used in batteries, construction materials, and as a shield against radiation.
if you mean lead the metal: Pb + 2H+ --> Pb+2 + H2
You mean Pb? It comes from the Latin for lead, plumbum.
What do the Y and Pb and Pr cables do and mean?What the Cables Do and Mean. Y=Green/sync, Pb=blue, Pr = red. These are video cables where the colors have been separated into it basic Green, Blue and Red signals. Makes it easier for the digital... Read More
10 Pin Bowling
"Love pb" could mean "love peanut butter" or "love private message" depending on the context it is used in.
Pb is the chemical abbreviation for lead, so perhaps it refers to a sample taken for lead level testing.