answersLogoWhite

0

What is CoS in chemistry?

Updated: 12/18/2022
User Avatar

Wiki User

13y ago

Best Answer

cobalt sulfide

User Avatar

Wiki User

13y ago
This answer is:
User Avatar

Add your answer:

Earn +20 pts
Q: What is CoS in chemistry?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

What does CoS stand for in chemistry?

CoS is the chemical formula of a possible cobalt sulfide.


How much money does forensic voice analyst earn?

how much do lab analysts earn.still a student and would like to know cos im doing B.s.c in chemistry how much do lab analysts earn.still a student and would like to know cos im doing B.s.c in chemistry


What is cos square?

Cos times Cos


Is cos squared x the same as cos x squared?

No. Cos squared x is not the same as cos x squared. Cos squared x means cos (x) times cos (x) Cos x squared means cos (x squared)


What is the best name for NaBr2?

NaBr2 is a chemistry related word meaning Sodium Bromide? Try Improve your answer cos it makes no sense to me....


What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?

cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.


Cos plus cos plus cos?

3cos


Cos x - cos x sin2 x equals cos3x?

cos(x)-cos(x)sin2(x)=[cos(x)][1-sin2(x)]cos(x)-cos(x)sin2(x)=[cos(x)][cos2(x)]cos(x)-cos(x)sin2(x)=cos3(x)


cos i?

cos i


Verify that sin minus cos plus 1 divided by sin plus cos subtract 1 equals sin plus 1 divided by cos?

[sin - cos + 1]/[sin + cos - 1] = [sin + 1]/cosiff [sin - cos + 1]*cos = [sin + 1]*[sin + cos - 1]iff sin*cos - cos^2 + cos = sin^2 + sin*cos - sin + sin + cos - 1iff -cos^2 = sin^2 - 11 = sin^2 + cos^2, which is true,


What is cos 495 degree's?

cos(495) = cos(495-360) = cos(135) = -cos(180-135) = -cos(45) = -sqrt(1/2) or -1/sqrt(2)


What is cos of a negative angle?

The cosine function is an even function which means that cos(-x) = cos(x). So, if cos of an angle is positive, then the cos of the negative of that angle is positive and if cos of an angle is negative, then the cos of the negative of that angle is negaitive.