0
Still curious? Ask our experts.
Chat with our AI personalities
BeauYou're doing better than you think!
Chat with Beau
SteveKnowledge is a journey, you know? We'll get there.
Chat with Steve
FranI've made my fair share of mistakes, and if I can help you avoid a few, I'd sure like to try.
Chat with FranAdd your answer:
Earn +20 ptsQ: What is the bond angle and the molecular geometry of NO3?
Write your answer...
Submit
Still have questions?
Continue Learning about Math & Arithmetic
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the number of moles in 132g Ba NO3 2?
Ba(NO3)2The total mass for this molecule is 261gso what is 261g/132g this is 1.97moles
What is the reaction equation for Pb NO3 2 plus KI?
yhujuhj
Is 60 a cube number?
no3³ = 274³ = 64if it is then somewhere between 3 and 4
What does nitrat oxidate number?
The oxidation number of nitrogen in the nitrate ion NO3- is 5
Trending Questions
Where would you be if you traveld 6000000 miles in space?
What are all the names of sweets that finish with the number 1?
How many kids are born in the world a day?
What is the circumference of a circle with a 7.5cm radius?
How to measure bra size?
What describes regression?
What is nought point one as a percentage?
What is the result of meiosis 1 and 2?
50 percentage of 100 is 50 what is 50 percentage of 200?
What is the sum of exterior angles in a 10 sided polygon?
Who were the seventeen enlisted men who overthrew tolbert?
What are the real rules regarding Roman numerals?
What is the sales tax percent for Aurora Colorado?
What is one thousand thirty nine in numerical format?
What does intraday mean?
What statement describes a graph that shows no identifiable trends?
What is the average square footage for department stores in malls?
X2 plus 3px plus p equals 0 what is p?
How many 100ths in 1 quarter?
What would you use to measure the diameter of a marble?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.