0
120o. The polyatomic ion is planar with a trigonal molecular geometry, a nitrogen atom with 3 equidistant O atoms at near 122 pm. All predictable ny VSEPR. The short bond length is attributed to pi bonding, the negative charge is spread across the three O atoms.
Add your answer:
Earn +20 pts
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the number of moles in 132g Ba NO3 2?
Ba(NO3)2The total mass for this molecule is 261gso what is 261g/132g this is 1.97moles
What is the reaction equation for Pb NO3 2 plus KI?
yhujuhj
Is 60 a cube number?
no3³ = 274³ = 64if it is then somewhere between 3 and 4
What does nitrat oxidate number?
The oxidation number of nitrogen in the nitrate ion NO3- is 5
Is Fe(NO3)2 Ionic or molecular?
Fe(NO3)2 is an ionic compound. Iron (Fe) is a metal and nitrate (NO3) is a polyatomic ion, so together they form an ionic bond in Fe(NO3)2.
Write the electronic and molecular geometry of NO3- and xeF2?
Trigonal Planar Electronic Geometry Geometry of Molecules: Trigonal Planar Three oxygen atoms are joined to the nitrogen atom in the NO3- ion to create a center atom. The configuration is trigonal planar, and the three oxygen atoms' bonds to the nitrogen atom have roughly 120-degree angles.
Is NO3-1 dipole?
Yes, NO3- is a polyatomic ion, and it has a trigonal planar molecular geometry with one nitrogen atom at the center and three oxygen atoms bonded to it. Due to its symmetrical shape, the NO3- ion has a net negative charge but is not considered a dipole.
What is the electronic geometry of bi3?
What is the electronic geometry of Bi_3? Enter the ... Thus, the total number of electrons in the molecule will be 24. There are no lone pairs in boron. Three electron domains are thus present in this molecule. Therefore, the electronic geometry of B I 3 is trigonal planar.
What is the molecular formula for gold nitrate?
The molecular formula for gold nitrate is Au(NO3)3.
Is no3 polar?
Yes, NO3- is a polar molecule because it has a trigonal planar molecular geometry with a net dipole moment due to the asymmetrical arrangement of atoms and lone pairs of electrons.
What are the resonance structures and molecular polarity of No3?
The resonance structures of NO3- involve moving a lone pair from one oxygen atom to form a double bond, resulting in three equivalent resonance structures. The trigonal planar arrangement of the three oxygen atoms gives a symmetrical molecule. As a result, the NO3- ion is nonpolar overall despite having polar bonds.
What type of bond is NH4NO3?
ionic bond as it contain two ion NH4+ and NO3-. NH4+ as it contain covalent bond between N and H. Also in NO3- oxygen bound by one covalent bond and one partial bond to each oxygen.
Is no3 ionic or molecular?
Lead nitrate is an ionic compound.
What is the correct molecular shape for no3?
trigonal planar
What is the molecular equation for calcium nitrate and copper sulfate?
The molecular equation for the reaction between calcium nitrate (Ca(NO3)2) and copper sulfate (CuSO4) is: Ca(NO3)2 + CuSO4 -> CaSO4 + Cu(NO3)2.
What is the molecular formula of zinc nitrate?
The molecular formula of zinc nitrate is Zn(NO3)2, which indicates that each formula unit contains one zinc ion (Zn) and two nitrate ions (NO3).
