answersLogoWhite

0

120o. The polyatomic ion is planar with a trigonal molecular geometry, a nitrogen atom with 3 equidistant O atoms at near 122 pm. All predictable ny VSEPR. The short bond length is attributed to pi bonding, the negative charge is spread across the three O atoms.

User Avatar

Wiki User

12y ago

What else can I help you with?

Continue Learning about Math & Arithmetic

Is No3 consists p and pi-d and pi bonds?

The nitrate ion (NO3-) consists of one nitrogen atom and three oxygen atoms. It features a resonance structure with one nitrogen-oxygen double bond (which includes a pi bond) and two nitrogen-oxygen single bonds, with the pi bond being delocalized over the three oxygen atoms. Therefore, in the nitrate ion, you have one sigma bond and one pi bond associated with the double bond, alongside the sigma bonds from the single bonds. However, it does not contain p bonds in the traditional sense, as the pi bond from the double bond is the primary interaction involving p orbitals.


What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?

NI(NO3)3+pbbr4nibr3+pb(no3)4


What is the number of moles in 132g Ba NO3 2?

Ba(NO3)2The total mass for this molecule is 261gso what is 261g/132g this is 1.97moles


What term is used to describe the 4 in the expression 4 Ca(NO3)2?

The term used to describe the 4 in the expression 4 Ca(NO3)2 is a "coefficient." It indicates the number of moles of the compound calcium nitrate (Ca(NO3)2) present in the chemical equation. In this case, it signifies that there are four moles of calcium nitrate.


What term is used to describe the 4 in the expression 4 CA (NO3)2?

The term used to describe the 4 in the expression 4 Ca(NO3)2 is a "coefficient." Coefficients indicate the number of units of a compound present in a chemical equation or formula. In this case, it signifies that there are four units of calcium nitrate (Ca(NO3)2).

Related Questions

Is Fe(NO3)2 Ionic or molecular?

Fe(NO3)2 is an ionic compound. Iron (Fe) is a metal and nitrate (NO3) is a polyatomic ion, so together they form an ionic bond in Fe(NO3)2.


Write the electronic and molecular geometry of NO3- and xeF2?

Trigonal Planar Electronic Geometry Geometry of Molecules: Trigonal Planar Three oxygen atoms are joined to the nitrogen atom in the NO3- ion to create a center atom. The configuration is trigonal planar, and the three oxygen atoms' bonds to the nitrogen atom have roughly 120-degree angles.


Is NO3-1 dipole?

The nitrate, NO3- ion is planar - each oxygen is identically charged. The central N atom carries a small positive charge. The symmetry means that there is no dipole as any bond dipoles cancel each other out.


What is the electronic geometry of bi3?

What is the electronic geometry of Bi_3? Enter the ... Thus, the total number of electrons in the molecule will be 24. There are no lone pairs in boron. Three electron domains are thus present in this molecule. Therefore, the electronic geometry of B I 3 is trigonal planar.


What is the molecular formula for gold nitrate?

The molecular formula for gold nitrate is Au(NO3)3.


Which of the molecules or ions below, NO, NO2, or NO3, will have the longest nitrogen-oxygen bond?

Among the molecules NO, NO2, and NO3, NO3 will have the longest nitrogen-oxygen bond.


Is no3 polar?

I think you mean the nitrate ion. Yes, that is a polyatomic ion with a negative charge. You write it as : NO3-


What are the resonance structures and molecular polarity of No3?

Ignore the placement of the periods, they are to space the models.Lines (\, /, |) represent bonds:O.....O.\\.../....N-...|....OO.....O..\..//....N-...|....OO.....O..\.../....N........OEach bond is distanced by a 120º angle.


Which of the molecules or ions below will have the strongest nitrogen-oxygen bond: NO, NO2, or NO3?

Among the molecules or ions NO, NO2, and NO3, the molecule with the strongest nitrogen-oxygen bond is NO3.


What type of bond is NH4NO3?

ionic bond as it contain two ion NH4+ and NO3-. NH4+ as it contain covalent bond between N and H. Also in NO3- oxygen bound by one covalent bond and one partial bond to each oxygen.


Is no3 ionic or molecular?

Lead nitrate is an ionic compound.


What is the correct molecular shape for no3?

trigonal planar