Want this question answered?
Be notified when an answer is posted
H3c h3c ch3 ch3
The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.
678 is divisible by 3.
A pyramid is a structure with a square at the bottom and 4 triangles connecting them. You have the correct word.
walmart and kmart
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
H3c h3c ch3 ch3
The correct NCOH Lewis structure shows nitrogen bonded to carbon, which is bonded to oxygen and hydrogen.
CHCL3
No, the correct form is "Is she correct?" The subject (she) comes before the verb (is) in English sentence structure.
It means it must be grammatically correct. The word spellings and the structure should be correct too.
The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.
The correct Lewis Structure for the oxygen atom will be an 'O' with two dots above and below, with one dot on the left and on the right sides.
Copper has a face-centered cubic (FCC) crystal structure.
The correct spelling is cistern (a rainwater collection and storage structure).
The correct spelling is "skeleton" (a structure of bones).
A virus has no cell structure, but it has genes :)