The correct structure of 3,3-dimethylhexane features a hexane backbone (six carbon atoms in a straight chain) with two methyl groups attached to the third carbon atom. This means the carbon chain is numbered from one end, and both methyl groups are located on the third carbon, making it a branched alkane. The molecular formula for 3,3-dimethylhexane is C8H18.
H3c h3c ch3 ch3
The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.
678 is divisible by 3.
The balanced chemical equation for the reaction is: 2 Al₂(CO₃)₃ + 3 ZnCl₂ → 3 ZnCO₃ + 2 AlCl₃. The correct coefficients in order are 2, 3, 3, and 2.
The ratio of correct to incorrect answers of 10 to 3 is 10:3. This means for every 10 correct answers, there are 3 incorrect ones. To express it in simplest form, it remains 10:3, as both numbers do not have a common divisor other than 1.
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
H3c h3c ch3 ch3
The correct NCOH Lewis structure shows nitrogen bonded to carbon, which is bonded to oxygen and hydrogen.
CHCL3
No, the correct form is "Is she correct?" The subject (she) comes before the verb (is) in English sentence structure.
It means it must be grammatically correct. The word spellings and the structure should be correct too.
The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.
The correct Lewis Structure for the oxygen atom will be an 'O' with two dots above and below, with one dot on the left and on the right sides.
The correct spelling is cistern (a rainwater collection and storage structure).
I would say Un Sacapuntas is the correct structure of copper
Two electrons in the first shell (closest to the nucleus), then five on the next shell out, usually shown as a pair and 3 singles.
A virus has no cell structure, but it has genes :)