answersLogoWhite

0

The correct structure of 3,3-dimethylhexane features a hexane backbone (six carbon atoms in a straight chain) with two methyl groups attached to the third carbon atom. This means the carbon chain is numbered from one end, and both methyl groups are located on the third carbon, making it a branched alkane. The molecular formula for 3,3-dimethylhexane is C8H18.

User Avatar

AnswerBot

8mo ago

What else can I help you with?

Related Questions

What is the correct structure of 3-ethyl-3-methylhexane?

The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3


What is the correct structure of 3-3-dimethylhexane?

H3c h3c ch3 ch3


What is the correct ncoh Lewis structure?

The correct NCOH Lewis structure shows nitrogen bonded to carbon, which is bonded to oxygen and hydrogen.


What is the correct Lewis structure for chloroform?

CHCL3


When speaking English is That is she correct?

No, the correct form is "Is she correct?" The subject (she) comes before the verb (is) in English sentence structure.


If the sentence to be is a correct sentence what is its meaning?

It means it must be grammatically correct. The word spellings and the structure should be correct too.


Why structure expressions in different ways?

The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.


The correct Lewis structure for the oxygen atom has?

The correct Lewis Structure for the oxygen atom will be an 'O' with two dots above and below, with one dot on the left and on the right sides.


How do you spell sisturn?

The correct spelling is cistern (a rainwater collection and storage structure).


What structure does copper have?

I would say Un Sacapuntas is the correct structure of copper


What is the correct Lewis structure for an Nitrogen atom?

Two electrons in the first shell (closest to the nucleus), then five on the next shell out, usually shown as a pair and 3 singles.


Which description of a virus is correct?

A virus has no cell structure, but it has genes :)