0
Want this question answered?
Be notified when an answer is posted
Add your answer:
Earn +20 pts
What is the correct structure of 3-3-dimethylhexane?
H3c h3c ch3 ch3
Why structure expressions in different ways?
The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.
Is 678 divisibility by 3 correct?
678 is divisible by 3.
What do you call a pyramid with a square at the bottom?
A pyramid is a structure with a square at the bottom and 4 triangles connecting them. You have the correct word.
3 examples of a surface structure?
walmart and kmart
What is the correct structure of 3-ethyl-3-methylhexane?
The correct structure of 3-ethyl-3-methylhexane is: CH3-CH2-CH(CH3)-CH2-CH(CH3)-CH3
What is the correct structure of 3-3-dimethylhexane?
H3c h3c ch3 ch3
What is the correct Lewis structure for chloroform?
CHCL3
When speaking English is That is she correct?
No, the correct form is "Is she correct?" The subject (she) comes before the verb (is) in English sentence structure.
If the sentence to be is a correct sentence what is its meaning?
It means it must be grammatically correct. The word spellings and the structure should be correct too.
Why structure expressions in different ways?
The structuring of expressions is to arrive at the correct answer. Using the 'Order of Precedence' : 1. Brackets; 2. Powers and Roots; 3. Multiplication and Division; 4. Addition and Subtraction, ensures that the correct answer is arrived at.
The correct Lewis structure for the oxygen atom has?
The correct Lewis Structure for the oxygen atom will be an 'O' with two dots above and below, with one dot on the left and on the right sides.
What structure does copper have?
Copper has a face-centered cubic (FCC) crystal structure.
How do you spell sisturn?
The correct spelling is cistern (a rainwater collection and storage structure).
How do you spell skelataon?
The correct spelling is "skeleton" (a structure of bones).
Which description of a virus is correct?
A virus has no cell structure, but it has genes :)
What is the correct Lewis structure for an Nitrogen atom?
Two electrons in the first shell (closest to the nucleus), then five on the next shell out, usually shown as a pair and 3 singles.
