answersLogoWhite

0


Want this question answered?

Be notified when an answer is posted

Add your answer:

Earn +20 pts
Q: Why DMA is given higher priority than proccesor?
Write your answer...
Submit
Still have questions?
magnify glass
imp
Related questions

Which compound has higher priority Br or OH?

The higher priority group is determined by the Cahn-Ingold-Prelog priority rules. In this case, the bromine atom (Br) usually has higher priority than the hydroxyl group (OH) because Br is heavier than O and has higher atomic number.


If RAM size is more than proccesor speed any problem?

It is impossible for "the RAM size to be higher than the processor speed." They are measured in totally different units, with no correlation between the two.


Which priority setting is given to the SCSI is number?

0 is highest, 15 is lowest. The highest-priority ID on the SCSI bus is 7. You normally assign this ID to the host adapter. Next in priority, from highest to lowest, are IDs 6-0 and then 15-8. So 0 has higher priority than 15.


When evaluing expression with more than one operations?

In that case, you need to know the rules about which operations to do first. In normal algebra, powers have a higher priority than multiplications and divisions; and these, in turn, have a higher priority than addition and subtraction.


When simplifying an expression you perform which operations inside grouping symbols first?

Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.


Can you say priority will be given to early bird?

i don't think so that proirity is given to bird because proirity is given to something that is very important to people rather than given it to somehow thank you


Can you change the name resolution order in windows?

Yes you can using the DWORD registry value DnsNbtLookupOrder that is lacated under the key HKLM\System|CurrentControlSet\Services\Tcpip\Parameters If the value is 0 NetBios has higher priority than DNS if the value is 1 DNS has higher priority than NetBios.


Can a person have more than one Garnishment at a time?

A person can have more than one garnishment at a time. The garnishment that has higher priority will be satisfied first.


Evaluate the following statements profit should be higher perority than social responsibility for business?

I think you mean priority...


What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl?

The highest priority substituent in this compound is the bromine atom (Br) attached to the carbon chain. This is determined based on the priority rules of the IUPAC nomenclature, where halogens have higher priority than alkyl groups or functional groups.


Why DMA access to main memory is given higher priority than processor access to main memory?

In a DMA while the data is transferred between the memory and the device, if it is stopped or interrupted by any other device like CPU, it would result into a Data loss, since DMA doesnt have a program counter unlike CPU which stores it current position. In CPU if it is interrupted, it suspends it s operation without any data loss. Hence DMA has a higher priority than CPU.


What is priority inversion?

Priority inversion is a situation where in lower priority tasks will run blocking higher priority tasks waiting for resource (mutex). For ex: consider 3 tasks. A, B and C, A being highest priority task and C is lowest. Look at sequence of context swaps A goes for I/O . unlocks mutex. C was ready to run. So C starts running. locks mutex B is ready to run. Swaps out C and takes mutex. A is ready to run. but A is blocked as mutex is locked by B. but B will never relinqishes the mutex as its higher priority than C. The solution to priority inversion is Priority inheritance.