answersLogoWhite

0

Direct Memory Access (DMA) is given higher priority than the processor because it allows peripheral devices to access system memory directly, bypassing the CPU, which enhances overall system efficiency. By enabling data transfer without CPU intervention, DMA reduces the processor's workload and allows it to focus on executing other tasks, leading to improved performance, especially in data-intensive applications. This prioritization is crucial for maintaining high throughput and minimizing latency in systems that require fast data transfers.

User Avatar

AnswerBot

6mo ago

What else can I help you with?

Continue Learning about Math & Arithmetic

When evaluing expression with more than one operations?

In that case, you need to know the rules about which operations to do first. In normal algebra, powers have a higher priority than multiplications and divisions; and these, in turn, have a higher priority than addition and subtraction.


How do you do order of operations with exponets and parenthesises?

Anything within parentheses should be evaluated first. Also, exponents have a higher priority than multiplication, division, addition or subtraction.


What is higher than a queen?

In a standard deck of playing cards, the rank higher than a queen is a king. In the context of royalty, the title higher than a queen is that of a king, emperor, or empress, depending on the specific hierarchy of a given monarchy. In some systems, such as the British royal family, the title of queen consort can be considered lower than that of a ruling king.


What is the use of random numbers in counseling?

A merit list will be prepared based on the total marks of 200. In cases where more than one candidate have got the same marks in the common merit list, the inter-se merit among such candidates shall be determined in the order of priority as specified belowPercentage of marks in MathematicsPercentage of marks in PhysicsPercentage of marks in the fourth optional subjectDate of Birth (elder will be given preference)Random number assigned (higher value will be given preference)


A data value that is much higher or lower than any other data values in a set?

the data value that is much higher or lower than the other data given is called an outlier

Related Questions

If RAM size is more than proccesor speed any problem?

It is impossible for "the RAM size to be higher than the processor speed." They are measured in totally different units, with no correlation between the two.


Which compound has higher priority Br or OH?

The higher priority group is determined by the Cahn-Ingold-Prelog priority rules. In this case, the bromine atom (Br) usually has higher priority than the hydroxyl group (OH) because Br is heavier than O and has higher atomic number.


Which priority setting is given to the SCSI is number?

0 is highest, 15 is lowest. The highest-priority ID on the SCSI bus is 7. You normally assign this ID to the host adapter. Next in priority, from highest to lowest, are IDs 6-0 and then 15-8. So 0 has higher priority than 15.


When evaluing expression with more than one operations?

In that case, you need to know the rules about which operations to do first. In normal algebra, powers have a higher priority than multiplications and divisions; and these, in turn, have a higher priority than addition and subtraction.


When simplifying an expression you perform which operations inside grouping symbols first?

Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.Within parentheses or similar symbols, the same rules apply as when you don't have parentheses. For example, multiplication and division have a higher priority (or precedence) than addition and subtraction.


Can you say priority will be given to early bird?

i don't think so that proirity is given to bird because proirity is given to something that is very important to people rather than given it to somehow thank you


Can you change the name resolution order in windows?

Yes you can using the DWORD registry value DnsNbtLookupOrder that is lacated under the key HKLM\System|CurrentControlSet\Services\Tcpip\Parameters If the value is 0 NetBios has higher priority than DNS if the value is 1 DNS has higher priority than NetBios.


Can a person have more than one Garnishment at a time?

A person can have more than one garnishment at a time. The garnishment that has higher priority will be satisfied first.


Evaluate the following statements profit should be higher perority than social responsibility for business?

I think you mean priority...


What is the highest priority substituent in CH3CH2CH2-CH2CH(CH3)2-CC-CH2CH2Br- CH2Cl?

The highest priority substituent in this compound is the bromine atom (Br) attached to the carbon chain. This is determined based on the priority rules of the IUPAC nomenclature, where halogens have higher priority than alkyl groups or functional groups.


Why DMA access to main memory is given higher priority than processor access to main memory?

In a DMA while the data is transferred between the memory and the device, if it is stopped or interrupted by any other device like CPU, it would result into a Data loss, since DMA doesnt have a program counter unlike CPU which stores it current position. In CPU if it is interrupted, it suspends it s operation without any data loss. Hence DMA has a higher priority than CPU.


What is priority inversion?

Priority inversion is a situation where in lower priority tasks will run blocking higher priority tasks waiting for resource (mutex). For ex: consider 3 tasks. A, B and C, A being highest priority task and C is lowest. Look at sequence of context swaps A goes for I/O . unlocks mutex. C was ready to run. So C starts running. locks mutex B is ready to run. Swaps out C and takes mutex. A is ready to run. but A is blocked as mutex is locked by B. but B will never relinqishes the mutex as its higher priority than C. The solution to priority inversion is Priority inheritance.