0
Performance bond
A surety bond between two parties, insuring one party against loss if the terms of a contract are not fulfilled. Usually part of a construction contract or supply agreement.
Wiki User
∙ 15y ago
Add your answer:
Earn +20 pts
What does pb plus 2 mean in chemistry?
An atom of lead that has bee stripped of two of its electrons.
How do you balance Pbo plus C equals Pb plus CO2?
2 PbO + C -> 2 Pb + CO2
Point b is the midpoint of the sequence pq the sequence pq is eight cm longer than the sequence pb what is the number of cm in the length of the sequence qb?
The whole sequence (pq) = pb + 8. b is the midpoint so pb = 1/2pq, making pb = 8 and bq also 8 cm
What does a punet square look like with a cross of PpBbWw and PpBbWw?
PP Pp PB Pb PW Pw pP pp pB pb pW pw BP Bp BB Bb BW Bw bP bp bB bb bW bw WP Wp WB Wb WW Ww wP wp wB wb wW ww
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
What is the meaning of the word in chemistry pb?
Pb is the international chemical symbol for Lead
What does PB mean in computer terms?
PB = PetaByte = 2 to the 50th = 1,125,899,906,842,624 bytes
What is Pb iv bicarbonate?
I think you mean Lead (IV) Bicarbonate, which is Pb(HCO3)4
What does PB mark on jewelry mean?
The "PB" is probably the manufacturer, The manufacturer is most likely Paul Brackna (PB), who is a master goldsmith and jewelry designer.
What does pb mean for cars?
Power breaks
What does PB mean in baseball?
Passed ball.
What does PB mean in a case number?
peanut butter
What is the balanced equation for the reaction of nitric acid on lead?
if you mean lead the metal: Pb + 2H+ --> Pb+2 + H2
Why does pd stand for lead?
You mean Pb? It comes from the Latin for lead, plumbum.
What does the Y Pb Pr cables do and mean?
What do the Y and Pb and Pr cables do and mean?What the Cables Do and Mean. Y=Green/sync, Pb=blue, Pr = red. These are video cables where the colors have been separated into it basic Green, Blue and Red signals. Makes it easier for the digital... Read More
What does this ditloid mean 10 pb?
10 Pin Bowling
What does PB sample mean in medical terminology?
Pb is the chemical abbreviation for lead, so perhaps it refers to a sample taken for lead level testing.
