0
Still curious? Ask our experts.
Chat with our AI personalities
Ross
Rafa
DevinAdd your answer:
Earn +20 pts
What is the name of the alkane having 5 carbons?
pentane
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What represents c6h14?
A saturated hydrocarbon (alkane). This can mean hexane, methyl pentane, ethyl butane, dimethyl butane etc.
What is a structural isomer and what are some examples?
In structural isomers, the atoms and functional groups are joined together in different ways.Text definition:Two or more substances composed of the same elements with the same proportions but differ in properties due to different arrangements of atoms.For more details see the Web Links to the left.First of all in organic chemistry you are always dealing with a string of Carbon atoms and an isomer both samples have the same amount of carbon atoms but have a different molecular structure an example would be Pentane and 2-Methyl Butane.
What did the Romans use catacombs for?
Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.
