0
It is a solvent.
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
What is the name of the alkane having 5 carbons?
pentane
What represents c6h14?
A saturated hydrocarbon (alkane). This can mean hexane, methyl pentane, ethyl butane, dimethyl butane etc.
What 2 4?
CH3-C(CH3)2-CH3-C(CH3)2-CH3 , 2,2,4,4-tetramethyl pentane
What is a structural isomer and what are some examples?
In structural isomers, the atoms and functional groups are joined together in different ways.Text definition:Two or more substances composed of the same elements with the same proportions but differ in properties due to different arrangements of atoms.For more details see the Web Links to the left.First of all in organic chemistry you are always dealing with a string of Carbon atoms and an isomer both samples have the same amount of carbon atoms but have a different molecular structure an example would be Pentane and 2-Methyl Butane.
What did the Romans use catacombs for?
Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.Catacombs were used for burial purposes.
What are pentane's biological uses?
Pentane does not have any significant biological uses. It is primarily used as a solvent in chemical laboratories and as a component in fuel blends.
what molecule has 5 carbon atom?
Pentane
Does pentane react with bromine water?
Yes, pentane can react with bromine water. In the presence of UV light, pentane can undergo a substitution reaction with bromine water where one or more hydrogen atoms are replaced by bromine atoms. This reaction can occur slowly at room temperature but is accelerated with the presence of UV light.
What is pentane used in?
it is used in comdoms to stop them from splitting so often
What material is pentane?
Pentane is a hydrocarbon compound and belongs to the alkane family. It is a colorless, highly flammable liquid that is often used as a solvent in the laboratory setting and as a fuel additive.
What is the nomenclature of pentane?
Pentane is the name in the IUPAC system
What is insolubles in pentane?
Insolubles in pentane refer to compounds or impurities that are not soluble in pentane. These insolubles may include solid particles, organic residue, or inorganic contaminants that are unable to dissolve in pentane. It is important to remove insolubles from pentane to maintain its purity for various industrial applications.
What organic compound contains 5 hydrocarbons and 2 hydroxyl groups?
Pentane 1,5 diol pentane 1,4 diol pentane 2,4 diol pentane 2,3 diol Neopentyl glycol
How many isomer does pentane have?
Pentane has three isomers: n-pentane, isopentane, and neopentane. These isomers have different structures due to the arrangement of carbon atoms in the molecule.
What CGA valve is used on pentane filled cylinder?
Typically, a CGA350 valve is used on pentane-filled cylinders. This valve is designed for flammable gases like pentane and ensures safe handling and use of the gas. Always check the specific requirements of the cylinder and consult with a professional to ensure proper valve compatibility.
What is the molecular mass in pentane?
Molecular mass of pentane is 72 u.
How many carbons does pentane have on iys structure?
Pentane has 5 carbon atoms in its structure.
