0
To find the missing probability ( P(B) ), you can use the formula for the probability of the union of two events: ( P(A \cup B) = P(A) + P(B) - P(A \cap B) ). Assuming ( P(A \cap B) = 0 ) (which is common unless otherwise specified), you can rearrange the equation: ( P(B) = P(A \cup B) - P(A) = 0.55 - 0.35 = 0.20 ). Thus, ( P(B) = 0.20 ).
What else can I help you with?
How do you balance Pbo plus C equals Pb plus CO2?
2 PbO + C -> 2 Pb + CO2
Point b is the midpoint of the sequence pq the sequence pq is eight cm longer than the sequence pb what is the number of cm in the length of the sequence qb?
The whole sequence (pq) = pb + 8. b is the midpoint so pb = 1/2pq, making pb = 8 and bq also 8 cm
What does a punet square look like with a cross of PpBbWw and PpBbWw?
PP Pp PB Pb PW Pw pP pp pB pb pW pw BP Bp BB Bb BW Bw bP bp bB bb bW bw WP Wp WB Wb WW Ww wP wp wB wb wW ww
What is the Roman numerals for Pb3N2?
The chemical formula Pb₃N₂ corresponds to lead(II) nitride. In this compound, lead (Pb) has a +2 oxidation state, which is denoted by the Roman numeral II. Therefore, the Roman numeral representation for Pb₃N₂ is lead(II) nitride.
What is this equation balanced ni no33ni no3 3 plus pbbr4 to nibr3 plus pb no3 4?
NI(NO3)3+pbbr4nibr3+pb(no3)4
How do you beat a PB when you have passed your peak?
When you've passed your peak the main things you are missing are strength and stamina therefore the only way you'll improve your PB is through improvement in technique or equipment
What does peanut butter go best with?
Cellery and PB PB & Jelly Chocolate and PB
What does the acronym PB stand for?
In the Penetrant PB B'laster, the PB stands for Penetrating B'laster.
Is Pb a element or compound?
Pb is a compound.
What is the Atomic Symbol for Lead?
Pb , derived from Plumbum.
How many protons does Pb have?
Lead or Pb ALWAYS has 82 protons.
The symbol Pb on the periodic table stands for?
Pb=Lead
How protons does Pb have?
Lead or Pb ALWAYS has 82 protons.
When was PB Max created?
PB Max was created in 1990.
When was PB Railroad created?
PB Railroad was created in 1974.
When did PB Railroad end?
PB Railroad ended in 1975.
Coding in c plus plus to swap two nos using pointer?
void swap (int &pa, int &pb) { *pa ^= *pb; *pb ^= *pa; *pa ^= *pb; }
