0
Assuming that the angles are all stated in degrees: sin(45) = cos(45) = 1/2 sqrt(2) sin(45) cos(45) = (1/2)2 x (2) = 1/2 sin(230) = - 0.7660444 sin(45) cos(45) - sin(230) = 0.5 + 0.7660444 = 1.2660444 (rounded)
Wiki User
∙ 14y ago
Add your answer:
Earn +20 pts
Is sin 2x equals 2 sin x cos x an identity?
YES!!!! Sin(2x) = Sin(x+x') Sin(x+x') = SinxCosx' + CosxSinx' I have put a 'dash' on an 'x' only to show its position in the identity. Both x & x' carry the same value. Hence SinxCosx' + CosxSinx' = Sinx Cos x + Sinx'Cosx => 2SinxCosx
If cos and theta 0.65 what is the value of sin and theta?
You can use the Pythagorean identity to solve this:(sin theta) squared + (cos theta) squared = 1.
How tan9-tan27-tan63 tan81 equals 4?
tan(9) + tan(81) = sin(9)/cos(9) + sin(81)/cos(81)= {sin(9)*cos(81) + sin(81)*cos(9)} / {cos(9)*cos(81)} = 1/2*{sin(-72) + sin(90)} + 1/2*{sin(72) + sin(90)} / 1/2*{cos(-72) + cos(90)} = 1/2*{sin(-72) + 1 + sin(72) + 1} / 1/2*{cos(-72) + 0} = 2/cos(72) since sin(-72) = -sin(72), and cos(-72) = cos(72) . . . . . (A) Also tan(27) + tan(63) = sin(27)/cos(27) + sin(63)/cos(63) = {sin(27)*cos(63) + sin(63)*cos(27)} / {cos(27)*cos(63)} = 1/2*{sin(-36) + sin(90)} + 1/2*{sin(72) + sin(36)} / 1/2*{cos(-36) + cos(90)} = 1/2*{sin(-36) + 1 + sin(36) + 1} / 1/2*{cos(-36) + 0} = 2/cos(36) since sin(-36) = -sin(36), and cos(-36) = cos(36) . . . . . (B) Therefore, by (A) and (B), tan(9) - tan(27) - tan(63) + tan(81) = tan(9) + tan(81) - tan(27) - tan(63) = 2/cos(72) – 2/cos(36) = 2*{cos(36) – cos(72)} / {cos(72)*cos(36)} = 2*2*sin(54)*sin(18)/{cos(72)*cos(36)} . . . . . . . (C) But cos(72) = sin(90-72) = sin(18) so that sin(18)/cos(72) = 1 and cos(36) = sin(90-36) = sin(54) so that sin(54)/cos(36) = 1 and therefore from C, tan(9) – tan(27) – tan(63) + tan(81) = 2*2*1*1 = 4
What is the half angle formula to find the exact value for tan 165?
tan u/2 = sin u/1+cos u
How do you prove that 2 sin 3x divided by sin x plus 2 cos 3x divided by cos x equals 8 cos 2x?
You need to know the trigonometric formulae for sin and cos of compound angles. sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) and cos(x+y) = cos(x)*cos(y) - sin(x)*sin(y) Using these, y = x implies that sin(2x) = sin(x+x) = 2*sin(x)cos(x) and cos(2x) = cos(x+x) = cos^2(x) - sin^2(x) Next, the triple angle formulae are: sin(3x) = sin(2x + x) = 3*sin(x) - 4*sin^3(x) and cos(3x) = 4*cos^3(x) - 3*cos(x) Then the left hand side = 2*[3*sin(x) - 4*sin^3(x)]/sin(x) + 2*[4*cos^3(x) - 3*cos(x)]/cos(x) = 6 - 8*sin^2(x) + 8cos^2(x) - 6 = 8*[cos^2(x) - sin^2(x)] = 8*cos(2x) = right hand side.
Find the value of a if tan 3a is equal to sin cos 45 plus sin 30?
If tan 3a is equal to sin cos 45 plus sin 30, then the value of a = 0.4.
Find the value of y if sin y equals cos 48?
y = arcsin( cos 48 ); arcsin may be seen as sin-1 on your calculator.
What is the value of sin A plus cos Acos A (1-cos A) when tan A 815?
When tan A = 815, sin A = 0.9999992 and cos A = 0.0012270 so that sin A + cos A*cos A*(1-cos A) = 1.00000075, approx.
Find the value of 3 sin 40 4 cos 20 - tan 45?
6.25
How do I find the product z1z2 if z1 5(cos20 plus isin20) and z2 8(cos15 plus isin15)?
Like normal expansion of brackets, along with: cos(A + B) = cos A cos B - sin A sin B sin(A + B) = sin A cos B + cos A sin B 5(cos 20 + i sin 20) × 8(cos 15 + i sin 15) = 5×8 × (cos 20 + i sin 20)(cos 15 + i sin 15) = 40(cos 20 cos 15 + i sin 15 cos 20 + i cos 15 sin 20 + i² sin 20 sin 15) = 40(cos 20 cos 15 - sin 20 cos 15 + i(sin 15 cos 20 + cos 15 sin 20)) = 40(cos(20 +15) + i sin(15 + 20)) = 40(cos 35 + i sin 35)
What is the exact value of the expression cos 7pi over 12 cos pi over 6 -sin 7pi over 12 sin pi over 6?
cos(a)cos(b)-sin(a)sin(b)=cos(a+b) a=7pi/12 and b=pi/6 a+b = 7pi/12 + pi/6 = 7pi/12 + 2pi/12 = 9pi/12 We want to find cos(9pi/12) cos(9pi/12) = cos(3pi/4) cos(3pi/4)= cos(pi-pi/4) cos(pi)cos(pi/4)-sin(pi)sin(pi/4) cos(pi)=-1 sin(pi)=0 cos(pi/4) = √2/2 sin(pi/4) =√2/2 cos(pi)cos(pi/4)-sin(pi)sin(pi/4) = - cos(pi/4) = -√2/2
Verify that sin minus cos plus 1 divided by sin plus cos subtract 1 equals sin plus 1 divided by cos?
[sin - cos + 1]/[sin + cos - 1] = [sin + 1]/cosiff [sin - cos + 1]*cos = [sin + 1]*[sin + cos - 1]iff sin*cos - cos^2 + cos = sin^2 + sin*cos - sin + sin + cos - 1iff -cos^2 = sin^2 - 11 = sin^2 + cos^2, which is true,
How do you prove this trigonometric relationship sin3A equals 3sinA cos 2 A - sin 3 A?
sin(3A) = sin(2A + A) = sin(2A)*cos(A) + cos(2A)*sin(A)= sin(A+A)*cos(A) + cos(A+A)*sin(A) = 2*sin(A)*cos(A)*cos(A) + {cos^2(A) - sin^2(A)}*sin(A) = 2*sin(A)*cos^2(A) + sin(a)*cos^2(A) - sin^3(A) = 3*sin(A)*cos^2(A) - sin^3(A)
How do you show that 2 sin squared x minus 1 divided by sin x minus cos x equals sin x plus cos x?
(2 sin^2 x - 1)/(sin x - cos x) = sin x + cos x (sin^2 x + sin^2 x - 1)/(sin x - cos x) =? sin x + cos x [sin^2 x - (1 - sin^2 x)]/(sin x - cos x) =? sin x + cos x (sin^2 x - cos^2 x)/(sin x - cos x) =? sin x + cos x [(sin x - cos x)(sin x + cos x)]/(sin x - cos x) =? sin x + cos x sin x + cos x = sin x + cos x
What is the numerical value of cos 35 x sin 24?
In degrees? cos(35˚) = .81915, sin(24˚) = .40673;cos(35˚) * sin(24˚) = .33318In radians? cos(35) = -.90367, sin(24) = -.90558;cos(35) * sin(24) = .81836A calculator will achieve these results faster than wiki.answers. 9 times out of 10, at least.:-)
How do you simplify cos times cot plus sin?
cos*cot + sin = cos*cos/sin + sin = cos2/sin + sin = (cos2 + sin2)/sin = 1/sin = cosec
Is sin 2x equals 2 sin x cos x an identity?
YES!!!! Sin(2x) = Sin(x+x') Sin(x+x') = SinxCosx' + CosxSinx' I have put a 'dash' on an 'x' only to show its position in the identity. Both x & x' carry the same value. Hence SinxCosx' + CosxSinx' = Sinx Cos x + Sinx'Cosx => 2SinxCosx
