The range for y = 4 cos (2x) is [-4, +4].
Not asked, but answered for completeness sake, the domain is [-infinity, +infinity].
sqrt(2)*cos(x + pi/4) [with x in radians], or sqrt(2)*cos(x + 90°) [with x in degrees]
-(4*log(2*cos(4*x)-4*cos(2*x)+3)-3*log(2*cos(4*x)+2)-2*log(2*cos(2*x)+2))/12
0.5
y = 4(2x) is an exponential function. Domain: (-∞, ∞) Range: (0, ∞) Horizontal asymptote: x-axis or y = 0 The graph cuts the y-axis at (0, 4)
Best way: Use angle addition. Sin(Ax)Cos(Bx) = (1/2) [sin[sum x] + sin[dif x]], where sum = A+B and dif = A-B To show this, Sin(Ax)Cos(Bx) = (1/2) [sin[(A+B) x] + sin[(A-B) x]] = (1/2) [(sin[Ax]Cos[Bx]+sin[Bx]cos[Ax]) + (sin[Ax]cos[-Bx]+sin[-Bx]cos[Ax])] Using the facts that cos[-k] = cos[k] and sin[-k] = -sin[k], we have: (1/2) [(sin[Ax]Cos[Bx]+sin[Bx]cos[Ax]) + (sin[Ax]cos[-Bx]+sin[-Bx]cos[Ax])] (1/2) [(sin[Ax]Cos[Bx]+sin[Bx]cos[Ax]) + (sin[Ax]cos[Bx]-sin[Bx]cos[Ax])] (1/2) 2sin[Ax]Cos[Bx] sin[Ax]Cos[Bx] So, Int[Sin(3y)Cos(5y)dy] = (1/2)Int[Sin(8y)-Sin(2y)dy] = (-1/16) Cos[8y] +1/4 Cos[2y] + C You would get the same result if you used integration by parts twice and played around with trig identities.
it equals 4
cot 70 + 4 cos 70 = cos 70 / sin 70 + 4 cos 70 = cos 70 (1/sin 70 + 4) = cos 70 (csc 70 + 4) Numerical answer varies, depending on whether 70 is in degrees, radians, or grads.
The derivative of cos(x) equals -sin(x); therefore, the anti-derivative of -sin(x) equals cos(x).
sqrt(2)*cos(x + pi/4) [with x in radians], or sqrt(2)*cos(x + 90°) [with x in degrees]
y=|x|/4 The range is [0 , ∞ )
cos(a)cos(b)-sin(a)sin(b)=cos(a+b) a=7pi/12 and b=pi/6 a+b = 7pi/12 + pi/6 = 7pi/12 + 2pi/12 = 9pi/12 We want to find cos(9pi/12) cos(9pi/12) = cos(3pi/4) cos(3pi/4)= cos(pi-pi/4) cos(pi)cos(pi/4)-sin(pi)sin(pi/4) cos(pi)=-1 sin(pi)=0 cos(pi/4) = √2/2 sin(pi/4) =√2/2 cos(pi)cos(pi/4)-sin(pi)sin(pi/4) = - cos(pi/4) = -√2/2
You cannot prove it because it is not true! cos(0) = 1 cos(2*pi) = 1 cos(4*pi) = 1 ... cos(2*k*pi) = 1 for all integers k or, if you still work in degrees, cos(0) = 1 cos(360) = 1 cos(720) = 1 ... cos(k*360) = 1 for all integers k
You must think of the unit circle. negative theta is in either radians or degrees and represents a specific area on the unit circle. Remember the unit circle is also like a coordinate plane and cos is the x while sin is the y coordinate. Here is an example: cos(-45): The cos of negative 45 degrees is pi/4 and cos(45) is also pi/4
11pi/12 = pi - pi/12 cos(11pi/12) = cos(pi - pi/12) cos(a-b) = cos(a)cos(b)+sin(a)sin(b) cos(pi -pi/12) = cos(pi)cos(pi/12) + sin(pi)sin(pi/12) sin(pi)=0 cos(pi)=-1 Therefore, cos(pi -pi/12) = -cos(pi/12) pi/12=pi/3 -pi/4 cos(pi/12) = cos(pi/3 - pi/4) = cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) cos(pi/3)=1/2 sin(pi/3)=sqrt(3)/2 cos(pi/4)= sqrt(2)/2 sin(pi/4) = sqrt(2)/2 cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) = (1/2)(sqrt(2)/2 ) + (sqrt(3)/2)( sqrt(2)/2) = sqrt(2)/4 + sqrt(6) /4 = [sqrt(2)+sqrt(6)] /4 Therefore, cos(pi/12) = (sqrt(2)+sqrt(6))/4 -cos(pi/12) = -(sqrt(2)+sqrt(6))/4 cos(11pi/12) = -(sqrt(2)+sqrt(6))/4
16
The range is {-5, -2, 1, 4}
You need to know the trigonometric formulae for sin and cos of compound angles. sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) and cos(x+y) = cos(x)*cos(y) - sin(x)*sin(y) Using these, y = x implies that sin(2x) = sin(x+x) = 2*sin(x)cos(x) and cos(2x) = cos(x+x) = cos^2(x) - sin^2(x) Next, the triple angle formulae are: sin(3x) = sin(2x + x) = 3*sin(x) - 4*sin^3(x) and cos(3x) = 4*cos^3(x) - 3*cos(x) Then the left hand side = 2*[3*sin(x) - 4*sin^3(x)]/sin(x) + 2*[4*cos^3(x) - 3*cos(x)]/cos(x) = 6 - 8*sin^2(x) + 8cos^2(x) - 6 = 8*[cos^2(x) - sin^2(x)] = 8*cos(2x) = right hand side.