answersLogoWhite

0

The range for y = 4 cos (2x) is [-4, +4].

Not asked, but answered for completeness sake, the domain is [-infinity, +infinity].

User Avatar

Wiki User

14y ago

What else can I help you with?

Related Questions

If θ is an acute angle and sin θ equals 2 then cos θ?

it equals 4


Cot 70 plus 4cos70 equals?

cot 70 + 4 cos 70 = cos 70 / sin 70 + 4 cos 70 = cos 70 (1/sin 70 + 4) = cos 70 (csc 70 + 4) Numerical answer varies, depending on whether 70 is in degrees, radians, or grads.


When does cos x equal -sin x?

The derivative of cos(x) equals -sin(x); therefore, the anti-derivative of -sin(x) equals cos(x).


What does cosx-sinx equals?

sqrt(2)*cos(x + pi/4) [with x in radians], or sqrt(2)*cos(x + 90°) [with x in degrees]


What is the range of the relation y equals to absolute value of x to 4?

y=|x|/4 The range is [0 , ∞ )


What is the exact value of the expression cos 7pi over 12 cos pi over 6 -sin 7pi over 12 sin pi over 6?

cos(a)cos(b)-sin(a)sin(b)=cos(a+b) a=7pi/12 and b=pi/6 a+b = 7pi/12 + pi/6 = 7pi/12 + 2pi/12 = 9pi/12 We want to find cos(9pi/12) cos(9pi/12) = cos(3pi/4) cos(3pi/4)= cos(pi-pi/4) cos(pi)cos(pi/4)-sin(pi)sin(pi/4) cos(pi)=-1 sin(pi)=0 cos(pi/4) = √2/2 sin(pi/4) =√2/2 cos(pi)cos(pi/4)-sin(pi)sin(pi/4) = - cos(pi/4) = -√2/2


How do you proof that there is one and only one value of theta makes cos of theta equals 1 true?

You cannot prove it because it is not true! cos(0) = 1 cos(2*pi) = 1 cos(4*pi) = 1 ... cos(2*k*pi) = 1 for all integers k or, if you still work in degrees, cos(0) = 1 cos(360) = 1 cos(720) = 1 ... cos(k*360) = 1 for all integers k


Why does cos negative theta equals positive theta?

You must think of the unit circle. negative theta is in either radians or degrees and represents a specific area on the unit circle. Remember the unit circle is also like a coordinate plane and cos is the x while sin is the y coordinate. Here is an example: cos(-45): The cos of negative 45 degrees is pi/4 and cos(45) is also pi/4


What is the exact value using a sum or difference formula of the expression cos 11pi over 12?

11pi/12 = pi - pi/12 cos(11pi/12) = cos(pi - pi/12) cos(a-b) = cos(a)cos(b)+sin(a)sin(b) cos(pi -pi/12) = cos(pi)cos(pi/12) + sin(pi)sin(pi/12) sin(pi)=0 cos(pi)=-1 Therefore, cos(pi -pi/12) = -cos(pi/12) pi/12=pi/3 -pi/4 cos(pi/12) = cos(pi/3 - pi/4) = cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) cos(pi/3)=1/2 sin(pi/3)=sqrt(3)/2 cos(pi/4)= sqrt(2)/2 sin(pi/4) = sqrt(2)/2 cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) = (1/2)(sqrt(2)/2 ) + (sqrt(3)/2)( sqrt(2)/2) = sqrt(2)/4 + sqrt(6) /4 = [sqrt(2)+sqrt(6)] /4 Therefore, cos(pi/12) = (sqrt(2)+sqrt(6))/4 -cos(pi/12) = -(sqrt(2)+sqrt(6))/4 cos(11pi/12) = -(sqrt(2)+sqrt(6))/4


How do you find the domain and range of y equals 12x-4?

16


What is the range of the linear equation if y equals 3x-5 and the Domain equals 0 1 2 or 3?

The range is {-5, -2, 1, 4}


How do you prove that 2 sin 3x divided by sin x plus 2 cos 3x divided by cos x equals 8 cos 2x?

You need to know the trigonometric formulae for sin and cos of compound angles. sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) and cos(x+y) = cos(x)*cos(y) - sin(x)*sin(y) Using these, y = x implies that sin(2x) = sin(x+x) = 2*sin(x)cos(x) and cos(2x) = cos(x+x) = cos^2(x) - sin^2(x) Next, the triple angle formulae are: sin(3x) = sin(2x + x) = 3*sin(x) - 4*sin^3(x) and cos(3x) = 4*cos^3(x) - 3*cos(x) Then the left hand side = 2*[3*sin(x) - 4*sin^3(x)]/sin(x) + 2*[4*cos^3(x) - 3*cos(x)]/cos(x) = 6 - 8*sin^2(x) + 8cos^2(x) - 6 = 8*[cos^2(x) - sin^2(x)] = 8*cos(2x) = right hand side.