answersLogoWhite

0

This is so much work that it is not worthwhile to do in practice, although the formulae themselves are actually quite simple. The basic method is to use a so-called "infinite series". The angle must be expressed in radians. If the angle is in degrees, multiply it by (pi/180), to get the equivalent angle in radians. Then, use the formula:

sin(x) = x - x3/3! + x5/5! - x7/7! + x9/9!...

The individual terms become smaller and smaller, quite quickly, so the idea is to continue adding more terms until you see that the terms become so small that you can ignore them (depending on the desired degree of accuracy). An expression like 5!, read "five factorial" or "the factorial of five", means to multiply all natural numbers up to five: 5! = 1 x 2 x 3 x 4 x 5.

Similarly,

cos(x) = 1 - x2/2! + x4/4! - x6/6! + x8/8!...

There is a more complicated formula for tan(x), or simply calculate as follows:

tan(x) = sin(x) / cos(x)

The formulae for sin(x) and cos(x) are derived from the Taylor expansion, explained in basic calculus books.

User Avatar

Wiki User

14y ago

What else can I help you with?

Continue Learning about Trigonometry

Can you transform sine functions into cosine functions?

If you know the measure of one angle, and the length of one side of a triangle, you can find the measures of the other sides and angles. From there, you can find the values of the other trig functions. cos (x) = sin (90-x) in degrees there are other identities such as cos^2+sin^2=1, so cos^2=1-sin^2


How tan9-tan27-tan63 tan81 equals 4?

tan(9) + tan(81) = sin(9)/cos(9) + sin(81)/cos(81)= {sin(9)*cos(81) + sin(81)*cos(9)} / {cos(9)*cos(81)} = 1/2*{sin(-72) + sin(90)} + 1/2*{sin(72) + sin(90)} / 1/2*{cos(-72) + cos(90)} = 1/2*{sin(-72) + 1 + sin(72) + 1} / 1/2*{cos(-72) + 0} = 2/cos(72) since sin(-72) = -sin(72), and cos(-72) = cos(72) . . . . . (A) Also tan(27) + tan(63) = sin(27)/cos(27) + sin(63)/cos(63) = {sin(27)*cos(63) + sin(63)*cos(27)} / {cos(27)*cos(63)} = 1/2*{sin(-36) + sin(90)} + 1/2*{sin(72) + sin(36)} / 1/2*{cos(-36) + cos(90)} = 1/2*{sin(-36) + 1 + sin(36) + 1} / 1/2*{cos(-36) + 0} = 2/cos(36) since sin(-36) = -sin(36), and cos(-36) = cos(36) . . . . . (B) Therefore, by (A) and (B), tan(9) - tan(27) - tan(63) + tan(81) = tan(9) + tan(81) - tan(27) - tan(63) = 2/cos(72) – 2/cos(36) = 2*{cos(36) – cos(72)} / {cos(72)*cos(36)} = 2*2*sin(54)*sin(18)/{cos(72)*cos(36)} . . . . . . . (C) But cos(72) = sin(90-72) = sin(18) so that sin(18)/cos(72) = 1 and cos(36) = sin(90-36) = sin(54) so that sin(54)/cos(36) = 1 and therefore from C, tan(9) – tan(27) – tan(63) + tan(81) = 2*2*1*1 = 4


What is cos2 A?

Cos(2A) = Cos(A + A) Double Angle Indentity Cos(A+A) = Cos(A)Cos(A) - Sin(A)Sin(A) => Cos^(2)[A] - SIn^(2)[A] => Cos^(2)[A] - (1 - Cos^(2)[A] => 2Cos^(2)[A] - 1


How do you prove that 2 sin 3x divided by sin x plus 2 cos 3x divided by cos x equals 8 cos 2x?

You need to know the trigonometric formulae for sin and cos of compound angles. sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) and cos(x+y) = cos(x)*cos(y) - sin(x)*sin(y) Using these, y = x implies that sin(2x) = sin(x+x) = 2*sin(x)cos(x) and cos(2x) = cos(x+x) = cos^2(x) - sin^2(x) Next, the triple angle formulae are: sin(3x) = sin(2x + x) = 3*sin(x) - 4*sin^3(x) and cos(3x) = 4*cos^3(x) - 3*cos(x) Then the left hand side = 2*[3*sin(x) - 4*sin^3(x)]/sin(x) + 2*[4*cos^3(x) - 3*cos(x)]/cos(x) = 6 - 8*sin^2(x) + 8cos^2(x) - 6 = 8*[cos^2(x) - sin^2(x)] = 8*cos(2x) = right hand side.


What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?

cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.

Related Questions

In and 8710ABC if sin A and tan A then what is cos A?

In a right triangle, if we know (\sin A) and (\tan A), we can find (\cos A) using the identity (\tan A = \frac{\sin A}{\cos A}). Rearranging this gives us (\cos A = \frac{\sin A}{\tan A}). Therefore, if you have specific values for (\sin A) and (\tan A), you can substitute them into this equation to find (\cos A).


How do you find sum of sin series?

You take the integral of the sin function, -cos, and plug in the highest and lowest values. Then subtract the latter from the former. so if "min" is the low end of the series, and "max" is the high end of the series, the answer is -cos(max) - (-cos(min)), or cos(min) - cos(max).


Sin and cosine values of 0?

sin 0 = 0 cos 0 = 1


How do I find the product z1z2 if z1 5(cos20 plus isin20) and z2 8(cos15 plus isin15)?

Like normal expansion of brackets, along with: cos(A + B) = cos A cos B - sin A sin B sin(A + B) = sin A cos B + cos A sin B 5(cos 20 + i sin 20) × 8(cos 15 + i sin 15) = 5×8 × (cos 20 + i sin 20)(cos 15 + i sin 15) = 40(cos 20 cos 15 + i sin 15 cos 20 + i cos 15 sin 20 + i² sin 20 sin 15) = 40(cos 20 cos 15 - sin 20 cos 15 + i(sin 15 cos 20 + cos 15 sin 20)) = 40(cos(20 +15) + i sin(15 + 20)) = 40(cos 35 + i sin 35)


Verify that sin minus cos plus 1 divided by sin plus cos subtract 1 equals sin plus 1 divided by cos?

[sin - cos + 1]/[sin + cos - 1] = [sin + 1]/cosiff [sin - cos + 1]*cos = [sin + 1]*[sin + cos - 1]iff sin*cos - cos^2 + cos = sin^2 + sin*cos - sin + sin + cos - 1iff -cos^2 = sin^2 - 11 = sin^2 + cos^2, which is true,


How do you prove this trigonometric relationship sin3A equals 3sinA cos 2 A - sin 3 A?

sin(3A) = sin(2A + A) = sin(2A)*cos(A) + cos(2A)*sin(A)= sin(A+A)*cos(A) + cos(A+A)*sin(A) = 2*sin(A)*cos(A)*cos(A) + {cos^2(A) - sin^2(A)}*sin(A) = 2*sin(A)*cos^2(A) + sin(a)*cos^2(A) - sin^3(A) = 3*sin(A)*cos^2(A) - sin^3(A)


Can you transform sine functions into cosine functions?

If you know the measure of one angle, and the length of one side of a triangle, you can find the measures of the other sides and angles. From there, you can find the values of the other trig functions. cos (x) = sin (90-x) in degrees there are other identities such as cos^2+sin^2=1, so cos^2=1-sin^2


Find the values of θ in the range 0 to 2π for cos θ plus cos 3θ equals sin θ plus sin 3θ?

The angle can be 0, pi/2, pi, 3*pi/2 or 2*pi radians.


How do you show that 2 sin squared x minus 1 divided by sin x minus cos x equals sin x plus cos x?

(2 sin^2 x - 1)/(sin x - cos x) = sin x + cos x (sin^2 x + sin^2 x - 1)/(sin x - cos x) =? sin x + cos x [sin^2 x - (1 - sin^2 x)]/(sin x - cos x) =? sin x + cos x (sin^2 x - cos^2 x)/(sin x - cos x) =? sin x + cos x [(sin x - cos x)(sin x + cos x)]/(sin x - cos x) =? sin x + cos x sin x + cos x = sin x + cos x


Using exact values find the numerical value of sin 30 degrees cos 240 degrees plus sin 210 degrees sin 300 degrees?

SQRT(3)/4 - 1/4


How do you simplify cos times cot plus sin?

cos*cot + sin = cos*cos/sin + sin = cos2/sin + sin = (cos2 + sin2)/sin = 1/sin = cosec


Factor sin cubed plus cos cubed?

sin cubed + cos cubed (sin + cos)( sin squared - sin.cos + cos squared) (sin + cos)(1 + sin.cos)