answersLogoWhite

0

The formula for (\tan(2x)) is given by the double angle identity:

[ \tan(2x) = \frac{2\tan(x)}{1 - \tan^2(x)} ]

This formula allows you to express the tangent of double an angle in terms of the tangent of the original angle (x).

User Avatar

AnswerBot

2mo ago

What else can I help you with?

Related Questions

What does tangent 2 x plus 1 equal?

tan(2x) = 2tanx/(1 - tan2x) So tan(2x) +1 = 2tanx/(1 - tan2x) + 1 = 2tanx/(1 - tan2x) + (1 - tan2x)/(1 - tan2x) = (-tan2x + 2tanx + 1)/(1 - tan2x)


What is the vertical asymptotes for tan2x?

there is non its an infinite line.


What is the range of y equals tan2x?

It depends on the domain of x.


How do you prove one - tan square x divided by one plus tan square xequal to cos two x?

(1 - tan2x)/(1 + tan2x) = (1 - sin2x/cos2x)/(1 + sin2x/cos2x) = (cos2x - sin2x)/(cos2x + sin2x) = (cos2x - sin2x)/1 = (cos2x - sin2x) = cos(2x)


How do you simplify tanx plus 1 sqaured?

I assume you mean (tanx+1)^2 In which case, (tanx+1)^2=tan2x+2tanx+1


What is the period of y equals tan2x?

The period of the tangent function is PI. The period of y= tan(2x) is PI over the coefficient of x = PI/2


What is the answer to cot squared x - tan squared x equals 0?

cot2x-tan2x=(cot x -tan x)(cot x + tan x) =0 so either cot x - tan x = 0 or cot x + tan x =0 1) cot x = tan x => 1 / tan x = tan x => tan2x = 1 => tan x = 1 ou tan x = -1 x = pi/4 or x = -pi /4 2) cot x + tan x =0 => 1 / tan x = -tan x => tan2x = -1 if you know about complex number then infinity is the solution to this equation, if not there's no solution in real numbers.


What is the answer to 2 tan 4x-tan2x-15 equals 0?

It is more than likely that the 4x and 2x do not refer to quadruple and double angles but to the powers of tan. However, given the limitations of the browser it is impossible to be sure.


What are five trigonometric identities?

All others can be derived from these and a little calculus: sin2x+cos2x=1 sec2x-tan2x=1 sin(a+b)=sin(a)cos(b)+sin(b)sin(a) cos(a+b)=cos(a)cos(b)-sin(a)sin(b) eix=cos(x)+i*sin(x)


How do you differentiate Tan2x?

Chain Rule: let u=2x and y=tan(u) du/dx = 2 and dy/du = sec^2(u) dy/dx = du/dx x dy/du multiply them together and replace u=2x into the equation.. therefore dy/dx = 2(sec^2(2x)) hope that helps.


How do you differentiate tan2 x?

By using the chain rule: dy/dx = dy/du x du/dx With y = tan2x Let u = tan x Then: y = u2 du/dx = d/dx tan x = sec2x dy/dx = dy/du x du/dx = 2u sec2x = 2 tan x sec2x


What is the chemical formula for calcium metal?

What Is The Formula What Is The Formula What Is The Formula For Calcium Phosphate ?