- (sq rt 2)/2 approx. -0.7071
You need to know the trigonometric formulae for sin and cos of compound angles. sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) and cos(x+y) = cos(x)*cos(y) - sin(x)*sin(y) Using these, y = x implies that sin(2x) = sin(x+x) = 2*sin(x)cos(x) and cos(2x) = cos(x+x) = cos^2(x) - sin^2(x) Next, the triple angle formulae are: sin(3x) = sin(2x + x) = 3*sin(x) - 4*sin^3(x) and cos(3x) = 4*cos^3(x) - 3*cos(x) Then the left hand side = 2*[3*sin(x) - 4*sin^3(x)]/sin(x) + 2*[4*cos^3(x) - 3*cos(x)]/cos(x) = 6 - 8*sin^2(x) + 8cos^2(x) - 6 = 8*[cos^2(x) - sin^2(x)] = 8*cos(2x) = right hand side.
sin^5 2x = 1/8 sin2x (cos(8x) - 4 cos(4x)+3)
cot 70 + 4 cos 70 = cos 70 / sin 70 + 4 cos 70 = cos 70 (1/sin 70 + 4) = cos 70 (csc 70 + 4) Numerical answer varies, depending on whether 70 is in degrees, radians, or grads.
cos(3t) = cos(2t + t) = cos(2t)*cos(t) - sin(2t)*sin(t) = [cos2(t) - sin2(t)]*cos(t) - 2*cos(t)*sin(t)*sin(t) = [cos2(t) - sin2(t)]*cos(t) - 2*cos(t)*sin2(t) then, since sin2(t) = 1 - cos2(t) = [2*cos2(t) - 1]*cos(t) - 2*cos(t)*[1 - cos2(t)] = 2*cos3(t) - cos(t) - 2*cos(t) + 2*cos3(t) = 4*cos3(t) - 3*cos(t)
cos(x)=sin(x-tau/4) tan(x)=sin(x)/cos(x) sin(x)=tan(x)*cos(x) cos(x)=tan(x-tau/4)*cos(x-tau/4) you can see that we have some circular reasoning going on, so the best we can do is express it as a combination of sines and cotangents: cos(x)=1/cot(x-tau/4)*sin(x-tau/2) tau=2*pi
11pi/12 = pi - pi/12 cos(11pi/12) = cos(pi - pi/12) cos(a-b) = cos(a)cos(b)+sin(a)sin(b) cos(pi -pi/12) = cos(pi)cos(pi/12) + sin(pi)sin(pi/12) sin(pi)=0 cos(pi)=-1 Therefore, cos(pi -pi/12) = -cos(pi/12) pi/12=pi/3 -pi/4 cos(pi/12) = cos(pi/3 - pi/4) = cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) cos(pi/3)=1/2 sin(pi/3)=sqrt(3)/2 cos(pi/4)= sqrt(2)/2 sin(pi/4) = sqrt(2)/2 cos(pi/3)cos(pi/4)+sin(pi/3) sin(pi/4) = (1/2)(sqrt(2)/2 ) + (sqrt(3)/2)( sqrt(2)/2) = sqrt(2)/4 + sqrt(6) /4 = [sqrt(2)+sqrt(6)] /4 Therefore, cos(pi/12) = (sqrt(2)+sqrt(6))/4 -cos(pi/12) = -(sqrt(2)+sqrt(6))/4 cos(11pi/12) = -(sqrt(2)+sqrt(6))/4
cos(a)cos(b)-sin(a)sin(b)=cos(a+b) a=7pi/12 and b=pi/6 a+b = 7pi/12 + pi/6 = 7pi/12 + 2pi/12 = 9pi/12 We want to find cos(9pi/12) cos(9pi/12) = cos(3pi/4) cos(3pi/4)= cos(pi-pi/4) cos(pi)cos(pi/4)-sin(pi)sin(pi/4) cos(pi)=-1 sin(pi)=0 cos(pi/4) = √2/2 sin(pi/4) =√2/2 cos(pi)cos(pi/4)-sin(pi)sin(pi/4) = - cos(pi/4) = -√2/2
-(4*log(2*cos(4*x)-4*cos(2*x)+3)-3*log(2*cos(4*x)+2)-2*log(2*cos(2*x)+2))/12
Well, darling, let me break it down for you. 1 over 3 is the same as 4 over 12 because they both simplify to 0.33. So, no, 1 over 3 is not greater than 4 over 12. It's like trying to argue that a slice of pie is bigger than the whole pie - it just doesn't add up.
All you need is knowledge of the sine and cosine ratios in a right angle triangle, and Pythagoras. Using Pythagoras you can work out the third side of the triangle which means you now know the value of cos B and so can substitute that into 3 cos B - 4 cos³ B and simplify it to see what the result is; if the result is 0, you have shown the required value. Try working it out before reading any further. -------------------------------------------------------------------------------- If you can't work it out by your self, read on: The sine ratio is opposite/hypotenuse The cosine ratio is adjacent/hypotenuse In a right angled triangle Pythagoras holds: hypotenuse² = adjacent² + opposite² → adjacent = √(hypotenuse² - opposite²) If sin B = 1/2 → opposite = 1, hypotenuse = 2 → adjacent = √(2² -1²) = √(4 - 1) = √3 → cos B = adjacent/hypotenuse = (√3)/2 → 3 cos B - 4 cos³ B = 3 × (√3)/2 - 4 × ((√3)/2)³ = 3(√3)/2 - 4((√3)²/2³) = 3(√3)/2 - 4(3(√3)/8) = 3(√3)/2 - 3(√3) × 4/8 = 3(√3)/2 - 3(√3)/2 = 0
You need to know the trigonometric formulae for sin and cos of compound angles. sin(x+y) = sin(x)*cos(y)+cos(x)*sin(y) and cos(x+y) = cos(x)*cos(y) - sin(x)*sin(y) Using these, y = x implies that sin(2x) = sin(x+x) = 2*sin(x)cos(x) and cos(2x) = cos(x+x) = cos^2(x) - sin^2(x) Next, the triple angle formulae are: sin(3x) = sin(2x + x) = 3*sin(x) - 4*sin^3(x) and cos(3x) = 4*cos^3(x) - 3*cos(x) Then the left hand side = 2*[3*sin(x) - 4*sin^3(x)]/sin(x) + 2*[4*cos^3(x) - 3*cos(x)]/cos(x) = 6 - 8*sin^2(x) + 8cos^2(x) - 6 = 8*[cos^2(x) - sin^2(x)] = 8*cos(2x) = right hand side.
No, four sixths is less than four thirds. I like to think of it this way: 1) Reduce: 4/6 = 2/3 4/3 = 4/3 (cannot be reduced) 2) Think of the fraction as a pie. You divide the pie in 3 ways (the denominator when both fractions are reduced) For the first pie, only 2 out of the 3 slices are being eaten. For the second pie, 4 out of 3....Then you think: well, 3/3 is one whole pie, so 4/3 means there is no excess, there is not enough. 3) Also, you can divide the numerator (the top number) into the denominator (the bottom number) to get percentages, and see which one is greater. So: 4 divided by 6 = .666...66 % 4 divided by 3 = 1.3...over 100% I hope this helped!
4/5
sin^5 2x = 1/8 sin2x (cos(8x) - 4 cos(4x)+3)
1/3 is a fraction less than one, because 3/3 is a whole. You only have 1 of the the 3 that is needed to make a whole. Think of pie (the kind you eat); you have 4 pieces of pie, then someone eats 2 pieces. How many pieces of pie do you have? 2 pieces! So you have 2 pieces of pie out of the 4 you originlly had. 2/4 of the pie is left. Does this help?
It is easiest to find these using the unit circle. Assuming you want exact values for sin, cos, and tan.240 degrees is equal to 4[Pi]/3 radians.cos(4[Pi]/3) and sin(4[Pi]/3) are easy to find using the unit circle,cos(4[Pi]/3) = -1/2sin(4[Pi]/3) = -(Sqrt[3])/2To find tan, you will need to do a little arithmetic. We know that tan(x) = sin(x)/cos(x), so,tan(4[Pi]/3) = sin(4[Pi]/3)/cos(4[Pi]/3)tan(4[Pi]/3) = (-(Sqrt[3])/2) / (-1/2)tan(4[Pi]/3) = ((Sqrt[3])/2) * (2/1)tan(4[Pi]/3) = ((Sqrt[3])*2) / (2*1)tan(4[Pi]/3) = (Sqrt[3]) / 1tan(4[Pi]/3) = Sqrt[3]Find the other 3 using reciprocal. This is just a little arithmetic and up to you. You know that cossec(x) = 1/sin(x), sec(x) = 1/cos(x) and cot(x) = cos(x)/sin(x).
cos pi over four equals the square root of 2 over 2 This value can be found by looking at a unit circle. Cos indicates it is the x value of the point pi/4 which is (square root 2 over 2, square root 2 over 2)