0
Still curious? Ask our experts.
Chat with our AI personalities
ReneChange my mind. I dare you.
Chat with Rene
TaigaEvery great hero faces trials, and you—yes, YOU—are no exception!
Chat with Taiga
JordanLooking for a career mentor? I've seen my fair share of shake-ups.
Chat with JordanAdd your answer:
Earn +20 ptsQ: Which expression completes the identity sin ucosv?
Write your answer...
Submit
Still have questions?
Continue Learning about Trigonometry
What is the expression of sine of 42-degrees?
Sin(42 o ) = 0.669130606 = 0.6691 ( 4 d.p._.
Is sin 2x equals 2 sin x cos x an identity?
YES!!!! Sin(2x) = Sin(x+x') Sin(x+x') = SinxCosx' + CosxSinx' I have put a 'dash' on an 'x' only to show its position in the identity. Both x & x' carry the same value. Hence SinxCosx' + CosxSinx' = Sinx Cos x + Sinx'Cosx => 2SinxCosx
If cos and theta 0.65 what is the value of sin and theta?
You can use the Pythagorean identity to solve this:(sin theta) squared + (cos theta) squared = 1.
What is this expression as the cosine of an angle cos30cos55 plus sin30sin55?
cos(30)cos(55)+sin(30)sin(55)=cos(30-55) = cos(-25)=cos(25) Note: cos(a)=cos(-a) for any angle 'a'. cos(a)cos(b)+sin(a)sin(b)=cos(a-b) for any 'a' and 'b'.
What is cos 360 minus theta?
Cos(360 - X) = Trig. Identity Cos(360)Cos(x) + Sin(360)Sin(x) => 1CosX + 0Sinx => CosX + o => CosX
Trending Questions
What is csc theta?
What is the answer to sinowhereght?
What does it mean when your girl friend puts her hand on top of yours?
What is a tetrarangle?
Can a tangent be negative?
Is at 3'oclock an adverb?
What is 3p means in Ray-ban sunglass?
What is the abstract noun of tan?
What is Rcos theta and Rsin Theta?
What does the metaphor incoming traffic stand for?
Is triangle a compound noun?
What does tragible mean?
WHAT IS THE PERCENTAGE OF MALE TO FEMALE TRANGENDERS VS FEMALE TO MALE?
Who is stronger Hinata or Neji?
What is the dhatu roop of gai?
What is the range of a trebuchet?
How do you wallclimbing trick in transformice?
Hip abduction occurs in in what plane of motion?
Which is greater tan 1tan2 tan3 .arrange them in descending order?
What are the 6 trig functions for 0 degrees 90 degrees 180 degrees 270 degrees?
Copyright ©2025 Infospace Holdings LLC, A System1 Company. All Rights Reserved. The material on this site can not be reproduced, distributed, transmitted, cached or otherwise used, except with prior written permission of Answers.